Methazolamide

{{distinguish|Thiamazole{{!}}methimazole|metamizole|acetazolamide}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 462249727

| IUPAC_name = N-[5-(aminosulfonyl)-3-methyl-1,3,4-thiadiazol-2(3H)-ylidene]acetamide

| image = Methazolamide.svg

| width = 220

| image2 = Methazolamide molecule ball.png

| alt2 = Ball-and-stick model of the methazolamide molecule

| tradename =

| Drugs.com = {{drugs.com|monograph|methazolamide}}

| MedlinePlus = a601233

| pregnancy_AU =

| pregnancy_US = C

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = Rx-only

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound = ~55%

| metabolism =

| elimination_half-life = ~14 hours

| excretion =

| IUPHAR_ligand = 6828

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 554-57-4

| ATC_prefix = S01

| ATC_suffix = EC05

| ATC_supplemental =

| PubChem = 4100

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00703

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3958

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W733B0S9SD

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D00655

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 19

| C=5 | H=8 | N=4 | O=3 | S=2

| smiles = O=S(=O)(C\1=N\N(C(=N/C(=O)C)/S/1)C)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C5H8N4O3S2/c1-3(10)7-4-9(2)8-5(13-4)14(6,11)12/h1-2H3,(H2,6,11,12)/b7-4-

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FLOSMHQXBMRNHR-DAXSKMNVSA-N

| synonyms = N-(3-Methyl-5-sulfamoyl-3H-1,3,4-thiadiazol-2-ylidene) ethanamide

}}

Methazolamide (trade name Neptazane) is a potent carbonic anhydrase inhibitor. It is indicated in the treatment of increased intraocular pressure (IOP) in chronic open-angle glaucoma and secondary glaucoma. Also it is used preoperatively in acute angle-closure (narrow-angle) glaucoma where lowering the IOP is desired before surgery.

This drug has displayed teratogenic effects in rats. Compared to another drug in the same class, acetazolamide, methazolamide requires a lower dose when administered to patients.

Recently, research has also uncovered a potential new role for this drug, addressing tau toxicity, a theorized cause for diseases such as Alzheimer’s. {{cite journal | vauthors = Lopez A, Siddiqi FH, Villeneuve J, Ureshino RP, Jeon HY, Koulousakis P, Keeling S, McEwan WA, Fleming A, Rubinsztein DC | title = Carbonic anhydrase inhibition ameliorates tau toxicity via enhanced tau secretion | journal = Nature Chemical Biology | pages = 577–587 | date = October 2024 | volume = 21 | issue = 4 | pmid = 39482469 | doi = 10.1038/s41589-024-01762-7 | doi-access = free | pmc = 11949835 }}

Methazolamide

References

Further reading