Methestrol dipropionate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [2-methyl-4-[4-(3-methyl-4-propanoyloxyphenyl)hexan-3-yl]phenyl] propanoate

| image = Methestrol dipropionate.svg

| width = 250px

| tradename = Meprane Dipropionate

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Nonsteroidal estrogen; Estrogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 130-73-4

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 199O25Z2BQ

| ATC_prefix =

| ATC_suffix =

| PubChem = 6765

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 6507

| synonyms = Methoestrol dipropionate; Metestrol dipropionate; Promethestrol dipropionate; Promethoestrol dipropionate; Dimethylhexestrol dipropionate

| C=26 | H=34 | O=4

| SMILES = CCC(C1=CC(=C(C=C1)OC(=O)CC)C)C(CC)C2=CC(=C(C=C2)OC(=O)CC)C

| StdInChI = 1S/C26H34O4/c1-7-21(19-11-13-23(17(5)15-19)29-25(27)9-3)22(8-2)20-12-14-24(18(6)16-20)30-26(28)10-4/h11-16,21-22H,7-10H2,1-6H3

| StdInChIKey = ORHVFDBDWJTZIN-UHFFFAOYSA-N

}}

Methestrol dipropionate or methoestrol dipropionate (brand name Meprane Dipropionate), also known as promethestrol dipropionate or promethoestrol dipropionate or as dimethylhexestrol dipropionate, is a synthetic nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that is or was used clinically.{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents |url= https://books.google.com/books?id=Z_mfTTIApVEC&pg=PA608|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=608–}}{{cite book| vauthors = Brucker MC, King TL |title=Pharmacology for Women's Health|url=https://books.google.com/books?id=ofCeCgAAQBAJ&pg=PT640|date=8 September 2015|publisher=Jones & Bartlett Learning|isbn=978-1-284-10811-8|pages=640–}}{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=A0THacd46ZsC&pg=PA1298|date=21 November 1996|publisher=Taylor & Francis|isbn=978-0-412-46630-4|pages=1298–}}{{cite book| vauthors = Thomas JA, Keenan EJ |title=Principles of Endocrine Pharmacology|url=https://books.google.com/books?id=mTagBQAAQBAJ&pg=PA150|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-1-4684-5036-1|pages=150–}}{{cite book | vauthors = Prasad A, Sinha AK |title=Essential of Endocrinology and Reproductive Physiology|year=1985|url=https://books.google.com/books?id=sKOwvts4me8C&pg=PA85|publisher=Allied Publishers|pages=85–|id=GGKEY:HLNJ1BHUKW2}}{{cite book| vauthors = Modell W |title=Drugs in Current Use 1958|url=https://books.google.com/books?id=v2vwCAAAQBAJ&pg=PA114|date=21 November 2013|publisher=Springer|isbn=978-3-662-40303-7|pages=114–}}{{cite book| vauthors = Dubin WR, Stolberg R |title=Emergency Psychiatry for the House Officer|url=https://books.google.com/books?id=IwboCAAAQBAJ&pg=PT155|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-6690-4|pages=155–}}{{cite book| vauthors = Raspé G |title=Hormones and Embryonic Development: Advances in The Biosciences|url=https://books.google.com/books?id=Xp3pAgAAQBAJ&pg=PA141|date=22 October 2013|publisher=Elsevier Science|isbn=978-1-4831-5171-7|pages=141–}} It is the dipropionate form of methestrol (or promethestrol), which, in contrast to methestrol dipropionate, was never marketed.