Methidathion
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 415702375
| ImageFile=Methidathion vector.svg
| ImageSize=200px
| PIN=S-[(5-Methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl phosphorodithioate
| OtherNames= Supracide, Ultracide, Suprathion
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13115
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C14431
| InChI = 1/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3
| InChIKey = MEBQXILRKZHVCX-UHFFFAOYAL
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 226651
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MEBQXILRKZHVCX-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=950-37-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y2P145U7KK
| PubChem=13709
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 34837
| SMILES = O=C1SC(=N/N1CSP(=S)(OC)OC)\OC
}}
|Section2={{Chembox Properties
| Formula=C6H11N2O4PS3
| MolarMass=302.331 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Methidathion is an organophosphate insecticide;{{cite journal|title=The effects of methidathion on liver: role of vitamins E and C|journal=Toxicology and Industrial Health|volume=19|issue=2–6|pages=63–67|doi=10.1191/0748233703th176oa|pmid=15697176|year=2016|last1=Gokalp|first1=Osman|last2=Gulle|first2=Kanat|last3=Sulak|first3=Osman|last4=Cicek|first4=Ekrem|last5=Altuntas|first5=Irfan|s2cid=23209774}} its use is banned in the European Union and USA.{{Cite web |url=http://www.pan-europe.info/Resources/Links/Banned_in_the_EU.pdf |title=Archived copy |access-date=2012-03-02 |archive-date=2013-06-05 |archive-url=https://web.archive.org/web/20130605090824/http://www.pan-europe.info/Resources/Links/Banned_in_the_EU.pdf |url-status=dead }}
Methidathion has been used as an insecticide in many countries to control caterpillars of Indarbela quadrinotata.{{cite web | url=http://kiengiangbiospherereserve.com.vn/project/uploads/doc/12.Control_bark_eating_caterpillar.pdf | title=CONTROL OF BARK EATING CATERPILLAR | publisher=German Development Cooperation | access-date=13 July 2016 | url-status=dead | archive-url=https://web.archive.org/web/20160813081430/http://kiengiangbiospherereserve.com.vn/project/uploads/doc/12.Control_bark_eating_caterpillar.pdf | archive-date=13 August 2016 }}
In 2012, residues were found in Thai vegetables at levels 100 times the legal limit. Thailand routinely uses many pesticides banned in the US and EU and in amounts far exceeding limits.{{Cite web|url=http://www.nationmultimedia.com/life/The-pesticides-on-our-plates-30188702.html|archive-url=https://web.archive.org/web/20120825015328/http://www.nationmultimedia.com/life/The-pesticides-on-our-plates-30188702.html|url-status=dead|archive-date=August 25, 2012|title = Nation Thailand news website, thai news, thailand news, Bangkok thailand, aec, breaking news : Nation Thailand}}
References
External links
- [http://extoxnet.orst.edu/pips/methidat.htm Extoxnet]
{{Insecticides}}
{{Acetylcholine metabolism and transport modulators}}
Category:Acetylcholinesterase inhibitors
Category:Organophosphate insecticides
{{Ether-stub}}