Methidiumpropyl-EDTA

{{Chembox

| ImageFile = Methidiumpropyl EDTA.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName = 3,8-Diamino-6-[4-[13-carboxy-9,12-bis(carboxymethyl)-1,7-dioxo-2,6,9,12-tetraazatridec-1-yl]phenyl]-5-methylphenanthridinium

| OtherNames = MPE

| Section1 = {{Chembox Identifiers

| CASNo = 80082-09-3

| ChemSpiderID = 3620842

| EC_number = 621-055-2

| PubChem = 4420455

| StdInChI=1S/C34H39N7O8/c1-39-28-16-24(36)8-10-26(28)25-9-7-23(35)15-27(25)33(39)21-3-5-22(6-4-21)34(49)38-12-2-11-37-29(42)17-40(18-30(43)44)13-14-41(19-31(45)46)20-32(47)48/h3-10,15-16,36H,2,11-14,17-20H2,1H3,(H7,35,37,38,42,43,44,45,46,47,48,49)/p+1

| StdInChIKey = XONAOTJPKINJQH-UHFFFAOYSA-O

| SMILES = O=C(O)CN(CC(=O)O)CCN(CC(=O)O)CC(=O)NCCCNC(=O)C1=CC=C(C=C1)C=2C3=CC(N)=CC=C3C=4C=CC(N)=CC4[N+]2C

}}

| Section2 = {{Chembox Properties

| C = 34 | H = 40 | N = 7 | O = 8 | Formula_Charge = +

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Methidiumpropyl-EDTA (MPE) is composed of the DNA intercalator methidium covalently attached to the metal chelator ethylenediaminetetraacetic acid (EDTA) by a short linker.{{cite journal | doi = 10.1093/nar/13.21.7759 | title = Self-catalyzed cyclization of the intervening sequence RNA of Tetrahymena:inhibition by methidiumpropyl-EDTA and localization of the major dye binding sites | year = 1985 | last1 = Tanner | first1 = N.Kyle | last2 = Cech | first2 = Thomas R. | journal = Nucleic Acids Research | volume = 13 | issue = 21 | pages = 7759–7779 | pmid = 2415924 | pmc = 322085 }} MPE nonspecifically binds and cleaves DNA at multiple locations.