Methoxmetamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| verifiedrevid =

| IUPAC_name = 2-(3-Methoxyphenyl)-2-(methylamino)cyclohexanone

| image = Methoxmetamine.png

| image_class = skin-invert-image

| width = 150

| tradename =

| legal_CA = Schedule I

| legal_UK = Class B

| legal_DE = NpSG

| CAS_number_Ref =

| CAS_number = 1781829-56-8

| CAS_supplemental =

| ATC_prefix =

| PubChem = 117067863

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U2B6L9JR4L

| ChemSpiderID = 58939253

| C=14 | H=19 | N=1 | O=2

| smiles = COC1=CC=CC(=C1)C2(CCCCC2=O)NC

| StdInChI = 1S/C14H19NO2/c1-15-14(9-4-3-8-13(14)16)11-6-5-7-12(10-11)17-2/h5-7,10,15H,3-4,8-9H2,1-2H3

| StdInChIKey = ZGQWDAOLJNAADS-UHFFFAOYSA-N

}}

Methoxmetamine (also known as 3-MeO-2'-Oxo-PCE, MXM and MMXE) is a dissociative anesthetic of the arylcyclohexylamine class that is closely related to methoxetamine and methoxyketamine, and has been sold online as a designer drug.{{cite journal | title=Three 25-NBOMe-type drugs, three other phenethylamine-type drugs (25I-NBMD, RH34, and escaline), eight cathinone derivatives, and a phencyclidine analog MMXE, newly identified in ingredients of drug products before they were sold on the drug market | vauthors = Kaizaki-Mitsumoto A, Noguchi N, Yamaguchi S, Odanaka Y, Matsubayashi S, Kumamoto H, Fukuhara K, Funada M, Wada K, Numazawa S | display-authors = 6 | journal=Forensic Toxicology |volume = 34|pages=108–114 | date=November 2015 | doi=10.1007/s11419-015-0293-6| s2cid = 45890497 }}