Methyl-DOB

{{chembox

| verifiedrevid = 415838126

| ImageFile = Methyl-DOB.png

| ImageSize = 200px

| PIN = 1-(4-Bromo-2,5-dimethoxyphenyl)-N-methylpropan-2-amine

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8261023

| InChI = 1/C12H18BrNO2/c1-8(14-2)5-9-6-12(16-4)10(13)7-11(9)15-3/h6-8,14H,5H2,1-4H3

| InChIKey = GURVSGCCXMIFMQ-UHFFFAOYAZ

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 351858

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H18BrNO2/c1-8(14-2)5-9-6-12(16-4)10(13)7-11(9)15-3/h6-8,14H,5H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GURVSGCCXMIFMQ-UHFFFAOYSA-N

| CASNo = 155638-80-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WW3LF52S82

| PubChem = 10085486

| SMILES = Brc1cc(OC)c(cc1OC)CC(NC)C

}}

|Section2={{Chembox Properties

| Formula = C₁₂H₁₈BrNO₂

| MolarMass = 288.181 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Methyl-DOB, or 4-bromo-2,5-dimethoxy-N-methylamphetamine, is a lesser-known psychedelic drug. It is similar in structure to DOB. Methyl-DOB was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 8 mg, and the effects onset begin after 3 hours and last up to 36 hours. Methyl-DOB produces many physical effects, such as mydriasis and muscle tenseness, but few psychoactive effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Methyl-DOB.