Methyl chlorate

{{short description|Chemical compound}}

{{orphan|date=May 2024}}

{{chembox

| Name = Methyl chlorate

| ImageFile = Methyl chlorate.svg

| OtherNames = Choric Acid, Methyl Ester

| IUPACName = methyl chlorate

| Section1 = {{Chembox Identifiers

| CASNo = 91589-75-2

| InChI = InChI=1S/CH3ClO3/c1-5-2(3)4/h1H3

| InChIKey = NHNMRJSHULPMIM-UHFFFAOYSA-N

| PubChem = 18695386

| SMILES = COCl(=O)=O

}}

| Section2 = {{Chembox Properties

| Formula = CH₃ClO₃

| LogP = 0.42{{cite web | title=methyl chlorate | website=SureChEMBL | date=2024-05-12 | url=https://www.surechembl.org/chemical/SCHEMBL3150615 | access-date=2024-05-12}}

| MolarMass = 98.4857 g/mol

}}

}}

Methyl chlorate is a hypothetical organic compound having a chemical formula CH₃ClO₃. It would be a methyl ester of chloric acid if it existed. Attempts to synthesize it failed.{{cite journal |last1=Hammond |first1=P. R. |title=259. Nuclear magnetic resonance of the methyl esters of some inorganic oxyacids |journal=Journal of the Chemical Society (Resumed) |date=1962 |pages=1370 |doi=10.1039/JR9620001370}} No physical properties are known.{{cite journal |last1=Brunswick |first1=Sara L. |last2=Ball |first2=David W. |title=Organic chlorate and perchlorate derivatives as high energy materials: High-level computations on methyl chlorate and methyl perchlorate |journal=Journal of Molecular Structure: THEOCHEM |date=October 2008 |volume=866 |issue=1–3 |pages=1–4 |doi=10.1016/j.theochem.2008.07.022}}