Methyltestosterone 3-hexyl ether
{{Short description|Synthetic anabolic-androgenic steroid and an androgen ether}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (8R,9S,10R,13S,14S,17S)-3-Hexoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol
| image = Methyltestosterone 3-hexyl ether.svg
| image_class = skin-invert-image
| width = 250px
| tradename = Androgénol, Enoltestovis, Enoltestovister
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 1852-73-9
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 92135812
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 52084721
| UNII = 3FFM4L8F61
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = 17α-Methyltestosterone 3-hexyl enol ether; 17α-Methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether; 3-(Hexyloxy)-17α-methylandrosta-3,5-dien-17β-ol
| C=26 | H=42 | O=2
| SMILES = CCCCCCOC1=CC2=CC[C@@H]3[C@@H]([C@]2(CC1)C)CC[C@]4([C@H]3CC[C@]4(C)O)C
| StdInChI_Ref =
| StdInChI = 1S/C26H42O2/c1-5-6-7-8-17-28-20-11-14-24(2)19(18-20)9-10-21-22(24)12-15-25(3)23(21)13-16-26(25,4)27/h9,18,21-23,27H,5-8,10-17H2,1-4H3/t21-,22+,23+,24+,25+,26+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = QPBGOXFXPXMJBT-UXUCURBISA-N
}}
Methyltestosterone 3-hexyl ether (brand names Androgénol, Enoltestovis, Enoltestovister), or 17α-methyltestosterone 3-hexyl enol ether, also known as 17α-methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether, is a synthetic anabolic-androgenic steroid and an androgen ether – specifically, the 3-hexyl ether of methyltestosterone.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=653–}}
See also
- Penmesterol (methyltestosterone 3-cyclopentyl enol ether)
References
{{Reflist}}
{{Androgens and antiandrogens}}
{{Androgen receptor modulators}}
Category:Anabolic–androgenic steroids
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}