Methyltestosterone 3-hexyl ether

{{Short description|Synthetic anabolic-androgenic steroid and an androgen ether}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,10R,13S,14S,17S)-3-Hexoxy-10,13,17-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol

| image = Methyltestosterone 3-hexyl ether.svg

| image_class = skin-invert-image

| width = 250px

| tradename = Androgénol, Enoltestovis, Enoltestovister

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1852-73-9

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 92135812

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 52084721

| UNII = 3FFM4L8F61

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = 17α-Methyltestosterone 3-hexyl enol ether; 17α-Methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether; 3-(Hexyloxy)-17α-methylandrosta-3,5-dien-17β-ol

| C=26 | H=42 | O=2

| SMILES = CCCCCCOC1=CC2=CC[C@@H]3[C@@H]([C@]2(CC1)C)CC[C@]4([C@H]3CC[C@]4(C)O)C

| StdInChI_Ref =

| StdInChI = 1S/C26H42O2/c1-5-6-7-8-17-28-20-11-14-24(2)19(18-20)9-10-21-22(24)12-15-25(3)23(21)13-16-26(25,4)27/h9,18,21-23,27H,5-8,10-17H2,1-4H3/t21-,22+,23+,24+,25+,26+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = QPBGOXFXPXMJBT-UXUCURBISA-N

}}

Methyltestosterone 3-hexyl ether (brand names Androgénol, Enoltestovis, Enoltestovister), or 17α-methyltestosterone 3-hexyl enol ether, also known as 17α-methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether, is a synthetic anabolic-androgenic steroid and an androgen ether – specifically, the 3-hexyl ether of methyltestosterone.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=653–}}

See also

  • Penmesterol (methyltestosterone 3-cyclopentyl enol ether)

References

{{Reflist}}

{{Androgens and antiandrogens}}

{{Androgen receptor modulators}}

Category:Abandoned drugs

Category:Androgen ethers

Category:Anabolic–androgenic steroids

Category:Androstanes

Category:Hepatotoxins

Category:Androgen esters

Category:Tertiary alcohols

{{Steroid-stub}}

{{Genito-urinary-drug-stub}}