Metixene

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 394273486

| IUPAC_name = 1-methyl-3-(9H-thioxanthen-9-ylmethyl)piperidine

| image = Methixene.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|metixene}}

| pregnancy_category =

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| legal_status =

| routes_of_administration =

| ATC_prefix = N04

| ATC_suffix = AA03

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7232

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 4969-02-2

| PubChem = 4167

| DrugBank = DB00340

| ChemSpiderID = 4023

| UNII = 32VY6L26ZW

| KEGG = D08209

| ChEBI = 51024

| ChEMBL = 1201342

| C=20 | H=23 | N=1 | S=1

| SMILES = CN1CCCC(C1)CC2C3=CC=CC=C3SC4=CC=CC=C24

| StdInChI = 1S/C20H23NS/c1-21-12-6-7-15(14-21)13-18-16-8-2-4-10-19(16)22-20-11-5-3-9-17(18)20/h2-5,8-11,15,18H,6-7,12-14H2,1H3

| StdInChIKey = MJFJKKXQDNNUJF-UHFFFAOYSA-N

}}

Metixene (brand names Methixart, CholinFall, Tremonil, Trest), also known as methixene, is an anticholinergic used as an antiparkinsonian agent.{{cite book | chapter = Metixene | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA178 | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=978-94-011-4439-1 |page=178}} It has also been reported to induce incomplete autophagy and cell death in metastatic cancer and brain metastases. {{cite journal |url=https://www.jci.org/articles/view/161142 |title=Metixene is an incomplete autophagy inducer in preclinical models of metastatic cancer and brain metastases |journal=Journal of Clinical Investigation |accessdate=3 November 2023 |doi=10.1172/JCI161142 |pmid=37847564 |year=2023|last1=Fares |first1=Jawad|doi-access=free |pmc=10721147 }}