Metodesnitazene

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{drugbox

| drug_name = Metodesnitazene

| image = Metodesnitazene.svg

| image_class = skin-invert-image

| legal_UK = PSA

| legal_US = Schedule I

| legal_DE =

| C = 21 | H = 27 | N = 3 | O = 1

| IUPAC_name = N,N-diethyl-2-[2-[(4-methoxyphenyl)methyl]benzimidazol-1-yl]ethanamine

| CAS_number = 14030-77-4

| CAS_supplemental =
1071546-40-1 (HCl)

| ChemSpiderID =

| PubChem = 26412

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TTR2RT8GBY

| smiles = CCN(CC)CCN1C2=CC=CC=C2N=C1CC3=CC=C(C=C3)OC

| StdInChI= 1S/C21H27N3O/c1-4-23(5-2)14-15-24-20-9-7-6-8-19(20)22-21(24)16-17-10-12-18(25-3)13-11-17/h6-13H,4-5,14-16H2,1-3H3

| StdInChIKey = SFNKTTXBZXVGOH-UHFFFAOYSA-N

}}

Metodesnitazene (also known as Metazene) is a benzimidazole derivative with opioid effects, though unlike related compounds such as metonitazene and etodesnitazene which are quite potent, metodesnitazene is only around the same potency as morphine in animal studies.{{cite journal | vauthors = Hunger A, Kebrle J, Rossi A, Hoffmann K | title = Benzimidazol-derivate und verwandte Heterocyclen. II. Synthese von 1-aminoalkyl-2-benzyl-benzimidazolen. | journal = Helvetica Chimica Acta | date = 1960 | volume = 43 | issue = 3 | pages = 800–809 | doi = 10.1002/hlca.19600430323 }}{{cite journal | vauthors = Vandeputte M, Van Uytfanghe K, Layle N, Germaine DS, Iula D, Stove C | title = Synthesis, chemical characterization, and µ-opioid receptor activity assessment of the emerging group of nitazene new synthetic opioids. | journal = Authorea |date=12 November 2020 | doi = 10.22541/au.160520665.59016513/v1 | s2cid = 234646245 }}{{cite journal | vauthors = Ujváry I, Christie R, Evans-Brown M, Gallegos A, Jorge R, de Morais J, Sedefov R | title = DARK Classics in Chemical Neuroscience: Etonitazene and Related Benzimidazoles | journal = ACS Chemical Neuroscience | volume = 12 | issue = 7 | pages = 1072–1092 | date = April 2021 | pmid = 33760580 | doi = 10.1021/acschemneuro.1c00037 | s2cid = 232356192 }}{{cite journal | vauthors = Lamy FR, Daniulaityte R, Barratt MJ, Lokala U, Sheth A, Carlson RG | title = "Etazene, safer than heroin and fentanyl": Non-fentanyl novel synthetic opioid listings on one darknet market | journal = Drug and Alcohol Dependence | volume = 225 | issue = | pages = 108790 | date = August 2021 | pmid = 34091156 | doi = 10.1016/j.drugalcdep.2021.108790 | s2cid = 235362241 }}{{cite journal | vauthors = Sisco E, Burns A, Moorthy A | title = Development and Evaluation of a Synthetic Opioid Targeted Gas Chromatography Mass Spectrometry (GC-MS) Method. | journal = Journal of Forensic Sciences | date = 2021 | volume = 66 | issue = 6 | pages = 2369–2380 | doi = 10.33774/chemrxiv-2021-0pcnq| pmid = 34459514 | pmc = 9922096 | s2cid = 240520700 }} It is illegal in both the US and UK.

See also

References