Midecamycin

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 444413988

| IUPAC_name = (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-4-(dimethylamino)-5-hydroxy-6-{[(4R,6S,7R,9R,10R,11E,13E,16R)-10-hydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)-4-(propanoyloxy)-1-oxacyclohexadeca-11,13-dien-6-yl]oxy}-2-methyloxan-3-yl]oxy}-4-hydroxy-2,4-dimethyloxan-3-yl propanoate

| image = Midecamycin.png

| tradename =

| Drugs.com = {{drugs.com|international|midecamycin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 35457-80-8

| ATC_prefix = J01

| ATC_suffix = FA03

| PubChem = 5382853

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445365

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = N34Z0Y5UH7

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01339

| C=41 | H=67 | N=1 | O=15

| smiles = O=CC[C@H]3C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@H](OC(=O)C[C@@H](OC(=O)CC)[C@H](OC)[C@H]3O[C@@H]2O[C@@H]([C@@H](O[C@@H]1O[C@H]([C@H](OC(=O)CC)[C@](O)(C1)C)C)[C@H](N(C)C)[C@H]2O)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C41H67NO15/c1-11-30(45)54-29-21-32(47)51-24(4)16-14-13-15-17-28(44)23(3)20-27(18-19-43)37(38(29)50-10)57-40-35(48)34(42(8)9)36(25(5)53-40)56-33-22-41(7,49)39(26(6)52-33)55-31(46)12-2/h13-15,17,19,23-29,33-40,44,48-49H,11-12,16,18,20-22H2,1-10H3/b14-13+,17-15+/t23-,24-,25-,26+,27+,28+,29-,33+,34-,35-,36-,37+,38+,39+,40+,41-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DMUAPQTXSSNEDD-QALJCMCCSA-N

| melting_point = 155

| melting_high = 156

| solubility = Soluble in acidic/low pH water; Very soluble in methanol, chloroform, ethyl acetate, benzene, ethyl ether; Almost completely in ethanol(>95.5)

}}

Midecamycin is a macrolide antibiotic{{cite journal | vauthors = Salhi A, Vindel JA, Brunaud M, Berceaux G, Marin A, Wuatelet C | title = Properties of midecamycin, a new macrolide antibiotic | journal = Giornale Italiano di Chemioterapia | volume = 24 | issue = 1–2 | pages = 67–76 | date = 1977 | pmid = 308022 }} that is synthesized from Streptomyces mycarofaciens.{{cite journal | vauthors = Wang YG, Hutchinson CR | title = Cloning of midecamycin biosynthetic genes from Streptomyces mycarofaciens 1748 | journal = Chinese Journal of Biotechnology | volume = 5 | issue = 4 | pages = 191–201 | date = 1989 | pmid = 2491329 }}