Migrastatin
{{chembox
| verifiedrevid = 462252424
| Name = Migrastatin
| ImageFile = Migrastatin.svg
| ImageName = Migrastatin
| PIN = 4-
| Section1 = {{Chembox Identifiers
| CASNo = 314245-65-3
| CASNo_Ref = {{Cascite|changed|CAS}}
| InChI = 1/C27H39NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7-8,12-14,17,19-20,22,26-27,33H,5-6,9-11,15-16H2,1-4H3,(H,28,30,31)/b12-7+,13-8+,18-14-/t17-,19-,22+,26+,27+/m1/s1
| InChIKey = OGYMUMAKGYYNHV-IJMHZYIBBB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H39NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7-8,12-14,17,19-20,22,26-27,33H,5-6,9-11,15-16H2,1-4H3,(H,28,30,31)/b12-7+,13-8+,18-14-/t17-,19-,22+,26+,27+/m1/s1
| SMILES = C[C@@H]1/C=C(\[C@H](OC(=O)/C=C/CC/C=C/[C@@H]([C@H]1O)OC)[C@H](C)C(=O)CCCC2CC(=O)NC(=O)C2)/C
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OGYMUMAKGYYNHV-IJMHZYIBSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 474321
| ChemSpiderID=21106454
| PubChem = 11016431
| ChEBI = 66389
}}
| Section2 = {{Chembox Properties
| Formula = C27H39NO7
| MolarMass = 489.60 g/mol}}
}}
Migrastatin is an organic compound which naturally occurs in the Streptomyces platensis bacteria. Migrastatin and several of its analogues (including Isomigrastatin) have shown to have potential in treating cancer, as it inhibits the metastasis of cancer cells.{{cite journal | author=Shan, D| title=Synthetic analogues of migrastatin that inhibit mammary tumor metastasis in mice | journal=PNAS | year=2005 | pages=3772–3776 | volume=102 | issue=10|doi=10.1073/pnas.0500658102 | pmid=15728385 | pmc=553334| bibcode=2005PNAS..102.3772S |display-authors=etal| doi-access=free }}