Mitapivat

{{Short description|Chemical compound}}

{{Use American English|date=February 2022}}

{{Use dmy dates|date=February 2022}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Mitapivat skeletal.svg

| image_class = skin-invert-image

| width =

| alt =

| caption =

| USAN = Mitapivat sulfate

| pronounce =

| tradename = Pyrukynd

| Drugs.com =

| MedlinePlus =

| licence_EU =

| DailyMedID = Mitapivat

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = By mouth

| class =

| ATCvet =

| ATC_prefix = B06

| ATC_suffix = AX04

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Pyrukynd- mitapivat tablet, film coated Pyrukynd- mitapivat kit | website=DailyMed | date=23 February 2022 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=4ccee896-e313-4c6c-9674-b4746ada0a90 | access-date=3 March 2022 | archive-date=3 March 2022 | archive-url=https://web.archive.org/web/20220303154400/https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=4ccee896-e313-4c6c-9674-b4746ada0a90 | url-status=live }}

| legal_EU = Rx-only

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| index2_label = as salt

| CAS_number = 1260075-17-9

| CAS_supplemental =

| PubChem = 59634741

| IUPHAR_ligand = 10473

| DrugBank = DB16236

| DrugBank2 = DBSALT003215

| ChemSpiderID = 29763395

| UNII = 2WTV10SIKH

| UNII2 = N4JTA67V3O

| KEGG =

| KEGG2 = D11408

| ChEBI =

| ChEMBL = 4299940

| ChEMBL2 = 4297223

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = AG-348

| IUPAC_name =

| C = 24 | H = 26 | N = 4 | O = 3 | S = 1

| SMILES = O=C(N1CCN(CC2CC2)CC1)C1=CC=C(NS(=O)(=O)C2=CC=CC3=C2N=CC=C3)C=C1

| StdInChI = 1S/C24H26N4O3S/c29-24(28-15-13-27(14-16-28)17-18-6-7-18)20-8-10-21(11-9-20)26-32(30,31)22-5-1-3-19-4-2-12-25-23(19)22/h1-5,8-12,18,26H,6-7,13-17H2

| StdInChI_comment =

| StdInChIKey = XAYGBKHKBBXDAK-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Mitapivat, sold under the brand name Pyrukynd, is a medication used to treat hemolytic anemia. It is taken as the sulfate hydrate salt by mouth. Mitapivat is a pyruvate kinase activator.

The most common side effects include decreases in estrone and estradiol (types of the estrogen hormone) in men, increased urate (a type of salt in the body), back pain, and joint stiffness.

Mitapivat was approved for medical use in the United States in February 2022,{{cite web | title=Drug Trials Snapshot: Pyrukynd | website=U.S. Food and Drug Administration (FDA) | date=1 June 2023 | url=https://www.fda.gov/drugs/drug-approvals-and-databases/drug-trials-snapshot-pyrukynd | access-date=1 June 2023}}{{dead link|date=May 2025|bot=medic}}{{cbignore|bot=medic}} {{PD-notice}}{{cite press release | title=Agios Announces FDA Approval of Pyrukynd (mitapivat) as First Disease-Modifying Therapy for Hemolytic Anemia in Adults with Pyruvate Kinase Deficiency | publisher=Agios Pharmaceuticals | via=GlobeNewswire | date=17 February 2022 | url=https://www.globenewswire.com/news-release/2022/02/17/2387542/31990/en/Agios-Announces-FDA-Approval-of-PYRUKYND-mitapivat-as-First-Disease-Modifying-Therapy-for-Hemolytic-Anemia-in-Adults-with-Pyruvate-Kinase-Deficiency.html | access-date=19 February 2022 | archive-date=20 February 2022 | archive-url=https://web.archive.org/web/20220220000640/https://www.globenewswire.com/news-release/2022/02/17/2387542/31990/en/Agios-Announces-FDA-Approval-of-PYRUKYND-mitapivat-as-First-Disease-Modifying-Therapy-for-Hemolytic-Anemia-in-Adults-with-Pyruvate-Kinase-Deficiency.html | url-status=live }}{{cite letter | vauthors = Gormley N | work = Center for Drug Evaluation and Research | publisher = U.S. Food and Drug Administration |subject = Pyrukynd (mitapivat) tablets NDA approval | recipient = Christina Baladi (Agios Pharmaceuticals, Inc.) | url = https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2022/216196Orig1s000ltr.pdf | archive-url = https://web.archive.org/web/20220220002649/https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2022/216196Orig1s000ltr.pdf | url-status = dead | archive-date = 20 February 2022 }} and in the European Union in November 2022. The US Food and Drug Administration (FDA) considers it to be a first-in-class medication.{{cite web | title=Advancing Health Through Innovation: New Drug Therapy Approvals 2022 | website=U.S. Food and Drug Administration (FDA) | date=10 January 2023 | url=https://www.fda.gov/drugs/new-drugs-fda-cders-new-molecular-entities-and-new-therapeutic-biological-products/new-drug-therapy-approvals-2022 | archive-url=https://web.archive.org/web/20230110192023/https://www.fda.gov/drugs/new-drugs-fda-cders-new-molecular-entities-and-new-therapeutic-biological-products/new-drug-therapy-approvals-2022 | url-status=dead | archive-date=10 January 2023 | access-date=22 January 2023}} {{PD-notice}}{{cite report | title=New Drug Therapy Approvals 2022 | website=U.S. Food and Drug Administration (FDA) | date=January 2024 | url=https://www.fda.gov/media/164429/download | format=PDF | access-date=14 January 2024 | archive-url=https://web.archive.org/web/20240114065648/https://www.fda.gov/media/164429/download | archive-date=14 January 2024 | url-status=dead }} {{PD-notice}}