Monatin

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 438855548

| ImageFile = Monatin.png

| ImageSize = 200px

| IUPACName = (4S)-4-Hydroxy-4-[(1H-indol-3-yl)methyl]-L-glutamic acid

| SystematicName = (2S,4S)-4-Amino-2-hydroxy-2-[(1H-indol-3-yl)methyl]pentanedioic acid

| OtherNames = 2-Hydroxy-2-(indol-3-ylmethyl)-4-aminoglutaric acid
(S)-4-Hydroxy-4-(1H-indol-3-ylmethyl)-L-glutamic acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 146142-94-1

| PubChem = 9860847

| SMILES = O[C@]([C@](O)=O)(C[C@H](N)C(O)=O)CC2=CNC1=CC=CC=C12

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8036546

| InChI = 1/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1

| InChIKey = RMLYXMMBIZLGAQ-HZMBPMFUBZ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RMLYXMMBIZLGAQ-HZMBPMFUSA-N

}}

|Section2={{Chembox Properties

| C=14 | H=16 | N=2 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Monatin, commonly known as arruva, is a naturally occurring, high intensity sweetener isolated from the plant Sclerochiton ilicifolius, found in the Transvaal region of South Africa. Monatin contains no carbohydrate or sugar, and nearly no food energy, unlike sucrose or other nutritive sweeteners.{{US patent application|20050106305}}, Timothy W. Abraham, Cargill

The name "monatin" is derived from the indigenous word for it, "molomo monate," which literally means "mouth nice.""Sweeteners and Sugar Alternatives in Food Technology," Kay O'Donnell and Malcolm Kearsley, 2012

Monatin is an indole derivative and, upon degradation, smells like feces."The Quest For a Natural Sugar Substitute," Daniel Engber, The New York Times, 01 January 2014[https://www.nytimes.com/2014/01/05/magazine/the-quest-for-a-natural-sugar-substitute.html]

It is 3000 times sweeter than sugar.{{Cite web|url=http://www.sugar-and-sweetener-guide.com/monatin.html|title = Monatin}}