Monoammonium glutamate
{{chembox
| Watchedfields = changed
| verifiedrevid = 419209529
| ImageFile=ammonium glutamate.png
| ImageSize=200px
| IUPACName=Azanium 4-amino-5-hydroxy-5-oxopentanoate
| OtherNames={{Unbulleted list|Ammonium glutamate}}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22622
| InChI = 1/C5H9NO4.H3N/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H3
| InChIKey = PHKGGXPMPXXISP-UHFFFAOYAV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H9NO4.H3N/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PHKGGXPMPXXISP-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=15673-81-1
| PubChem=24200
| SMILES = O=C([O-])CCC(N)C(=O)O.[NH4+]
}}
|Section2={{Chembox Properties
| C=5 | H=12 | N=2 | O=4
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Monoammonium glutamate is a compound with formula NH4C5H8NO4. It is an ammonium acid salt of glutamic acid.
It has the E number E624 and is used as a flavor enhancer.
See also
{{DEFAULTSORT:Monoammonium Glutamate}}
{{Organic-compound-stub}}