Monometacrine
{{Short description|Abandoned antidepressant}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = Monometacrine.svg
| image_class = skin-invert-image
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 4757-49-7
| CAS_supplemental =
| PubChem = 145765
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 128589
| UNII = 3FDC82890Y
| KEGG =
| ChEBI =
| ChEMBL = 2104752
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = Desmethyldimetacrine; Nordimetacrine; N-Desmethyldimetacrine; SD-735; NSC-100296
| IUPAC_name = 3-(9,9-dimethylacridin-10-yl)-N-methylpropan-1-amine
| C=19 | H=24 | N=2
| SMILES = CC1(C2=CC=CC=C2N(C3=CC=CC=C31)CCCNC)C
| StdInChI = 1S/C19H24N2/c1-19(2)15-9-4-6-11-17(15)21(14-8-13-20-3)18-12-7-5-10-16(18)19/h4-7,9-12,20H,8,13-14H2,1-3H3
| StdInChIKey = PGSOFANFWNSSRA-UHFFFAOYSA-N
}}
Monometacrine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name SD-735), also known as desmethyldimetacrine, is a drug of the tricyclic family described as an antidepressant which was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA835 | access-date=20 October 2024 | page=835}}{{cite book | vauthors = Negwer M, Scharnow HG | title=Organic-chemical Drugs and Their Synonyms: An International Survey | publisher=Wiley-VCH | issue=v. 3 | year=2001 | isbn=978-3-527-30247-5 | url=https://books.google.com/books?id=zmpqAAAAMAAJ | access-date=20 October 2024 | page=1788}}{{cite web | title= Monometacrine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS) | url=https://drugs.ncats.io/drug/3FDC82890Y | access-date=20 October 2024}} It was first described in the literature by 1966. The drug is the N-desmethyl analogue of dimetacrine and is a metabolite of dimetacrine.
References
{{Reflist}}
{{Tricyclics}}
Category:Experimental antidepressants
Category:Human drug metabolites
Category:Tricyclic antidepressants
{{Psychoactive-stub}}