Moperone

{{Short description|Chemical compound}}

{{Drugbox

| drug_name = Moperone

| IUPAC_name = 1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one

| image = Moperone.svg

| image_class = skin-invert-image

| width = 250px

| tradename = Luvatren (discontinued)

| ATC_prefix = N05

| ATC_suffix = AD04

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1050-79-9

| PubChem = 4249

| DrugBank = DB13554

| ChemSpiderID = 4100

| UNII = OU730881W5

| KEGG = D02623

| C=22 | H=26 | F=1 | N=1 | O=2

| SMILES = CC1=CC=C(C=C1)C1(O)CCN(CCCC(=O)C2=CC=C(F)C=C2)CC1

| StdInChI = 1S/C22H26FNO2/c1-17-4-8-19(9-5-17)22(26)12-15-24(16-13-22)14-2-3-21(25)18-6-10-20(23)11-7-18/h4-11,26H,2-3,12-16H2,1H3

| StdInChIKey = AGAHNABIDCTLHW-UHFFFAOYSA-N

}}

Moperone (Luvatren, since discontinued) is a typical antipsychotic of the butyrophenone class{{cite journal | vauthors = Gross H, Kaltenbäck E | title = The clinical position of moperone among the butyrophenones | journal = Nordisk Psykiatrisk Tidsskrift. Nordic Journal of Psychiatry | volume = 23 | issue = 1 | pages = 4–9 | year = 1969 | pmid = 5354545 | doi = 10.3109/08039486909132154 }} which is marketed in Japan for the treatment of schizophrenia. It is an antagonist for the D₂ (K_i 0.7–1.9 nM), D₃ (K_i 0.1–1 nM), and 5-HT_2A (K_i 52 nM) receptors. It also has a high binding affinity for the sigma receptors.{{cite book | vauthors = Miyamoto S | chapter = Moperone | date = 2010 | chapter-url = https://doi.org/10.1007/978-3-540-68706-1_1838 | title = Encyclopedia of Psychopharmacology | pages = 798 | veditors = Stolerman IP | place = Berlin, Heidelberg | publisher = Springer | doi = 10.1007/978-3-540-68706-1_1838 | isbn = 978-3-540-68706-1 | access-date = 21 March 2022}}{{cite web | title = PDSP K_i Database | work = Psychoactive Drug Screening Program (PDSP)|author1-link=Bryan Roth | vauthors = Roth BL, Driscol J | publisher = University of North Carolina at Chapel Hill and the United States National Institute of Mental Health | access-date = 21 March 2022 | url = https://pdsp.unc.edu/databases/pdsp.php?receptorDD=&receptor=&speciesDD=&species=&sourcesDD=&source=&hotLigandDD=&hotLigand=&testLigandDD=&testFreeRadio=testFreeRadio&testLigand=moperone&referenceDD=&reference=&KiGreater=&KiLess=&kiAllRadio=all&doQuery=Submit+Query}}