Morantel

{{Chembox

| ImageFile = Morantel.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 1-Methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethen-1-yl]-1,4,5,6-tetrahydropyrimidine

| OtherNames = Morantel tartrate; Paratect

| Section1 = {{Chembox Identifiers

| CASNo = 20574-50-9

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEBI = 94736

| ChEMBL = 1240978

| ChemSpiderID1 = 4101

| EC_number = 243-890-8

| KEGG = C08230

| PubChem = 5353792

| UNII = 7NJ031HAX5

| StdInChI=1S/C12H16N2S/c1-10-6-9-15-11(10)4-5-12-13-7-3-8-14(12)2/h4-6,9H,3,7-8H2,1-2H3/b5-4+

| StdInChIKey = NVEPPWDVLBMNMB-SNAWJCMRSA-N

| SMILES = CC1=C(SC=C1)C=CC2=NCCCN2C

}}

| Section2 = {{Chembox Properties

| C=12|H=16|N=2|S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Morantel is an anthelmintic drug used for the removal of parasitic worms in livestock. It affects the nervous system of worms given the drug is an inhibitor of acetylcholinesterase.{{Cite web |url=http://parasitipedia.net/index.php?option=com_content&view=article&id=2706&Itemid=3007 |title=MORANTEL: SAFETY SUMMARY for VETERINARY use in Cattle, Sheep, Goats, and Horses. Poisoning, intoxication, overdose, antidote |website=PARASITIPEDIA.net|access-date=2018-02-21}} It is derived in part from 3-methylthiophene. Morantel is closely related to pyrantel.{{cite book| first = Jonathan | last = Swanston |chapter = Thiophene | title = Ullmann's Encyclopedia of Industrial Chemistry | publisher = Wiley-VCH | location = Weinheim | date = 2006 | doi = 10.1002/14356007.a26_793.pub2| isbn = 3527306730 }}.