Moroxydine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444172916

| ImageFile=Moroxydine.png

| IUPACName=N-(Diaminomethylidene)morpholine-4-carboximidamide

| OtherNames=Moroxidine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=3731-59-7

| PubChem=71655

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07250

| SMILES=C1COCCN1C(=N)N=C(N)N

| EINECS = 223-093-1

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64715

| InChI = 1/C6H13N5O/c7-5(8)10-6(9)11-1-3-12-4-2-11/h1-4H2,(H5,7,8,9,10)

| InChIKey = KJHOZAZQWVKILO-UHFFFAOYAH

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H13N5O/c7-5(8)10-6(9)11-1-3-12-4-2-11/h1-4H2,(H5,7,8,9,10)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KJHOZAZQWVKILO-UHFFFAOYSA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O611591WAH

}}

|Section2={{Chembox Properties

| Formula=C₆H₁₃N₅O

| MolarMass=171.20 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = J05

| ATCCode_suffix = AX01

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Moroxydine is an antiviral drug that was originally developed in the 1950s as an influenza treatment. It has potential applications against a number of RNA and DNA viruses.{{Cite journal

| last1 = Sheppard | first1 = S.

| title = Moroxydine: The story of a mislaid antiviral

| journal = Acta Dermato-Venereologica. Supplementum

| volume = 183

| pages = 1–9

| year = 1994

| pmid = 9868507

}} Structurally moroxydine is a heterocyclic biguanidine.{{cn|date=January 2023}}

It was reported in March 2014 that three kindergartens in two provinces of China had been found to be secretly dosing their students with moroxydine hydrochloride to try to prevent them from becoming ill. The kindergartens are paid only for the days that pupils attend and wanted to ensure that they maximised their earnings.{{cite news|last=Moore|first=Malcolm|title=China: All children to be given drug tests after schools caught medicating pupils|url=http://www.theage.com.au/world/china-all-children-to-be-given-drug-tests-after-schools-caught-medicating-pupils-20140320-hvkpf.html|accessdate=2014-03-20|newspaper=The Age|date=2014-03-20}}