Morphinone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462255579

| ImageFile = Morphinone.svg

| ImageClass = skin-invert-image

| ImageName = Structural formula

| ImageFile1 = Morphinone molecule spacefill.png

| ImageClass1 = bg-transparent

| ImageName1 = Space-filling model

| IUPACName = (5α)-3-Hydroxy-17-methyl-7,8-didehydro-4,5-epoxy-morphinan-6-one

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4573586

| InChI = 1/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1

| InChIKey = PFBSOANQDDTNGJ-YNHQPCIGBO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PFBSOANQDDTNGJ-YNHQPCIGSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 467-02-7

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 255467

| PubChem = 5459823

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 28MBK63MAW

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16315

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C01735

| SMILES = O=C1\C=C/[C@H]5[C@@H]4N(CC[C@@]52c3c(O[C@@H]12)c(O)ccc3C4)C

}}

|Section2={{Chembox Properties

| C=17 | H=17 | N=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Morphinone is an opioid that is the intermediate when morphine is being converted to hydromorphone (trade name Dilaudid).{{cite book | title = Comprehensive Natural Products III | isbn = 978-0-08-102691-5 | editor = Hung-Wen (Ben) Liu and Tadhg P. Begley | date = 2020 | publisher = Elsevier }}

Chemical structure

Morphinone can be described as the ketone of morphine.

Legal status

Morphinone itself is an active opioid, though its potency is closer to codeine than morphine.{{cn|date=February 2023}} It is, however, an important precursor and would fall under the purview of the Controlled Substances Act within the United States. Its legal status in other countries varies.

References