Muldamine
{{short description|Organic compound, phytosterol alkaloid}}
{{Chembox
| ImageFile = Muldamine.png
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 240
| ImageName = Stereo skeletal formula of muldamine
| ImageFile1 = Muldamine molecule ball.png
| ImageSize1 = 240
| ImageAlt1 = Ball-and-stick model of muldamine
| IUPACName = 3β-Hydroxy-16,28-seco-22β-solanid-5-en-16α-yl acetate
| SystematicName = (1R,2R,3aS,3bS,7S,9aR,9bS,11aS)-7-Hydroxy-9a,11a-dimethyl-1-{(1S)-1-[(2S,5S)-5-methylpiperidin-2-yl]ethyl}-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl acetate
| OtherNames = Alkaloid Q
Teinemine 16-acetate
5-Veratranine-3β,11α-diol 11-acetate
|Section1={{Chembox Identifiers
| CASNo = 36069-45-1
| CASNo_Ref = {{cascite|correct|}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q683N7457H
| PubChem = 21575037
| ChemSpiderID = 10183538
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| MeSHName = Muldamine
| SMILES = CC(C1C(CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)OC(C)=O)C1CCC(C)CN1
| StdInChI=1S/C29H47NO3/c1-17-6-9-25(30-16-17)18(2)27-26(33-19(3)31)15-24-22-8-7-20-14-21(32)10-12-28(20,4)23(22)11-13-29(24,27)5/h7,17-18,21-27,30,32H,6,8-16H2,1-5H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZVYUDNWAHWVPPN-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=29 | H=47 | N=1 | O=3
}}
}}
Muldamine is a phytosterol alkaloid isolated from Veratrum californicum.{{cite journal | doi = 10.1016/0039-128X(71)90033-X | author = Keeler R F | title = Teratogenic compounds of Veratrum californicum (Durand). 13. Structure of muldamine | journal = Steroids | year = 1971 | volume = 18 | issue = 6 | pages = 741–752 | pmid = 5135731}} It is the acetate ester of the piperidine steroid teinemine.{{cite journal | doi = 10.1016/0031-9422(82)85214-X | title = Structure of the steroidal alkaloid muldamine and its deacetyl derivative |author1=Gaffield, William |author2=Wong, Rosalind Y. |author3=Lundin, Robert E. |author4=Keeler, Richard F. | journal = Phytochemistry | year = 1982 | volume = 21 | issue = 9 | pages = 2397–2400| bibcode = 1982PChem..21.2397G | s2cid = 84867178 }}
See also
References
{{Reflist}}
{{alkaloid-stub}}
{{Steroid-stub}}