Muscazone

{{Chembox

| Watchedfields = changed

| verifiedrevid = 426003687

| ImageFileL1 = muscazone.png

| ImageFileR1= Muscazone_3d_structure.png

| IUPACName = 2-Amino-2-(2-oxo-3H-1,3-oxazol-5-yl)acetic acid

| OtherNames =

|Section1={{Chembox Identifiers

| InChI = 1/C5H6N2O4/c6-3(4(8)9)2-1-7-5(10)11-2/h1,3H,6H2,(H,7,10)(H,8,9)/t3-/m1/s1

| InChIKey = ASBGWPLVVIASBE-GSVOUGTGBI

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C5H6N2O4/c6-3(4(8)9)2-1-7-5(10)11-2/h1,3H,6H2,(H,7,10)(H,8,9)/t3-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ASBGWPLVVIASBE-GSVOUGTGSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 2255-39-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K97K88B7WE

| PubChem = 92925

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=16735919

| SMILES = O=C([O-])[C@H]([NH3+])C\1=C\NC(=O)O/1

| EINECS = 218-853-4

}}

|Section2={{Chembox Properties

| C=5 | H=6 | N=2 | O=4

| Appearance = Crystalline solid

| Density =

| MeltingPtC = 190

| MeltingPt_notes = (decomposes)Merck Index, 12th Edition, 6390

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Muscazone is a toxic chemical compound. It is an amino acid found in European fly agaric mushrooms.

Consumption causes visual damage, mental confusion, and memory loss.{{Cite book | title = Lewis' Dictionary of Toxicology | author = Robert Alan Lewis | page = 719 | publisher = CRC Press | date = 1998 | isbn = 978-0849366079}}

Image:Amanita muscaria 2.jpg contains muscazone]]{{clear|left}}