Mutisianthol

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462256195

| ImageFile = Mutisianthol.svg

| ImageSize =

| PIN = (1S,3R)-3,6-Dimethyl-1-(2-methylprop-1-en-1-yl)-2,3-dihydro-1H-inden-5-ol

| SystematicName =

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 70855-59-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F69DJ259PV

| EINECS =

| PubChem = 12168490

| DTXSID = DTXSID20479072

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24750874

| SMILES = Cc1cc2c(cc1O)[C@@H](C[C@H]2C=C(C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H20O/c1-9(2)5-12-6-10(3)13-8-15(16)11(4)7-14(12)13/h5,7-8,10,12,16H,6H2,1-4H3/t10-,12-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SVNPNOPENVFTBB-ZYHUDNBSSA-N

| RTECS =

| MeSHName =

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=15 | H=20 | O=1

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Mutisianthol is a sesquiterpene compound found in Mutisia homoeantha. It was first isolated by Bohlmann et al. in 1979.{{cite journal| author=da Silva, Gil V. J. |author2=Álvaro Cunha Neto | date=2005-08-08 | title=Calculated NMR as a tool for structural elucidation of jungianol and mutisianthol | journal=Tetrahedron | volume=61 | issue=32 | pages=7763–7767 | doi=10.1016/j.tet.2005.05.101}}