N'-Formylkynurenine

{{DISPLAYTITLE:N'-Formylkynurenine}}

{{chembox

| Watchedfields = changed

| verifiedrevid = 437363582

| Name={{prime|N}}-Formylkynurenine

| ImageFile=N-formyl-L-kynurenine.svg

| ImageSize=

| SystematicName=(2S)-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid

| OtherNames={{prime|N}}-Formyl-L-kynurenine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=3978-11-8

| ChEBI = 30249

| ChEMBL = 3577708

| ChemSpiderID = 388843

| KEGG = C02700

| PubChem=439788

| UNII=PS20W0733S

| StdInChI=1S/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17)/t8-/m0/s1

| StdInChIKey = BYHJHXPTQMMKCA-QMMMGPOBSA-N

| SMILES=C1=CC=C(C(=C1)C(=O)C[C@@H](C(=O)O)N)NC=O

| MeSHName=N'-formylkynurenine

}}

|Section2={{Chembox Properties

| C=11 | H=12| N=2| O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPtC=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

{{prime|N}}-Formylkynurenine is an intermediate in the catabolism of tryptophan. It is a formylated derivative of kynurenine. The formation of {{prime|N}}-formylkynurenine is catalyzed by heme dioxygenases.{{Cite journal | doi = 10.1021/ja207066z | pmid = 21892828 | title = The Mechanism of Formation of N-Formylkynurenine by Heme Dioxygenases | journal = Journal of the American Chemical Society | volume = 133 | issue = 40 | pages = 16251–16257 | year = 2011 | last1 = Basran | first1 = Jaswir | last2 = Efimov | first2 = Igor | last3 = Chauhan | first3 = Nishma | last4 = Thackray | first4 = Sarah J | last5 = Krupa | first5 = James L | last6 = Eaton | first6 = Graham | last7 = Griffith | first7 = Gerry A | last8 = Mowat | first8 = Christopher G | last9 = Handa | first9 = Sandeep | last10 = Raven | first10 = Emma Lloyd | pmc = 3210546| bibcode = 2011JAChS.13316251B }}