N-Methyliminodiacetic acid

{{DISPLAYTITLE:N-Methyliminodiacetic acid}}

{{Chembox

| Name = N-Methyliminodiacetic acid

| ImageFile = MIDA acid.svg

| ImageSize = 110

| ImageAlt =

| IUPACName =

| OtherNames = N-(Carboxymethyl)-N-methyl-glycine

|Section1={{Chembox Identifiers

| CASNo = 4408-64-4

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEMBL = 1741474

| ChemSpiderID = 19251

| EC_number = 224-557-6

| PubChem = 20441

| UNII = SH1YP5H4NA

| StdInChI=1S/C5H9NO4/c1-6(2-4(7)8)3-5(9)10/h2-3H2,1H3,(H,7,8)(H,9,10)

| StdInChIKey = XWSGEVNYFYKXCP-UHFFFAOYSA-N

| SMILES = CN(CC(=O)O)CC(=O)O

}}

|Section2={{Chembox Properties

| C=5|H = 9|N=1|O=4

| MolarMass =

| Appearance = white solid

| Density =

| MeltingPtC = 223–225

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| GHS_ref={{cite web |title=N-Methyliminodiacetic acid |url=https://pubchem.ncbi.nlm.nih.gov/compound/20441#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+351+338|319|321|332+317|337+317|362+364|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

N-Methyliminodiacetic acid is an organic compound with the formula {{chem2|CH3N(CH2CO2H)2}}. It is a white solid, which as its conjugate base {{chem2|CH3N(CH2CO2-)2}} is used as a chelating agent for iron.{{cite journal |doi=10.1128/aem.62.1.288-291.1996 |title=Rapid Anaerobic Benzene Oxidation with a Variety of Chelated Fe(III) Forms |date=1996 |last1=Lovley |first1=D. R. |last2=Woodward |first2=J. C. |last3=Chapelle |first3=F. H. |journal=Applied and Environmental Microbiology |volume=62 |issue=1 |pages=288–291 |pmid=16535218 |pmc=1388759 |bibcode=1996ApEnM..62..288L }} It is a component of organoboron reagents as well.{{cite book |doi=10.1002/047084289X.rn01228.pub2 |chapter=N -(Carboxymethyl)- N -methyl-glycine |title=Encyclopedia of Reagents for Organic Synthesis |date=2010 |last1=Dailey |first1=Ian |last2=Burke |first2=Martin D. |isbn=978-0471936237 }}