N-Octyl bicycloheptene dicarboximide

{{DISPLAYTITLE:N-Octyl bicycloheptene dicarboximide}}

{{chembox

| Name=N-Octyl bicycloheptene dicarboximide

| verifiedrevid = 432140479

| ImageFile = N-Octyl_bicycloheptene_dicarboximide.svg

| ImageSize = 250px

| ImageFile2 = MGK 264 3D BS.png

| ImageSize2 = 250px

| IUPACName = 4-(2-Ethyl-hexyl)-4-aza-tricyclo[5.2.1.0^2,6]dec-8-ene-3,5-dione

| OtherNames = MGK-264
Pyrodone
N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 113-48-4

| ChEBI = 81966

| ChEMBL = 1874490

| ChemSpiderID = 7934

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1B9RV7L76C

| PubChem = 8227

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18795

| SMILES = O=C(N3CC(CC)CCCC)C1C(C3=O)C2C=CC1C2

}}

|Section2={{Chembox Properties

| Formula = C₁₇H₂₅NO₂

| MolarMass = 275.386 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

N-Octyl bicycloheptene dicarboximide (MGK 264)[http://hpd.nlm.nih.gov/cgi-bin/household/brands?tbl=chem&id=638 Household Products Database], U.S. Department of Health and Human Services, hhs.gov is an ingredient in some common pesticides. It has no intrinsic pesticidal qualities itself, but rather is a synergist enhancing the potency of pyrethroid ingredients. It is used in a variety of household and veterinary products.

MGK 264 is starting to appear on pesticide monitoring lists by states legalizing and mandating pesticide monitoring in medical and recreational cannabis. This is most likely due to the very large amounts of pyrethroids that are used in cannabis monitoring lists and the likelihood of MGK 264 usage to maximize yield.{{cite web |author1=State of Missouri |title=Mo. Code Regs. tit. 19 § 30-95.070 |url=https://casetext.com/regulation/missouri-administrative-code/title-19-department-of-health-and-senior-services/division-30-division-of-regulation-and-licensure/chapter-95-medical-marijuana/section-19-csr-30-95070-testing-facility |website=casetext.com |publisher=casetext |access-date=25 October 2022}}