NBUMP
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 424813377
| IUPAC_name = N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide
| image = NBUMP.png
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 134390-72-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G184WXO36J
| ATC_prefix = none
| ATC_suffix =
| PubChem = 64622
| ChemSpiderID = 58183
| C=26 | H=39 | N=3 | O=2
| smiles = COc1ccccc1N2CCN(CC2)CCCCNC(=O)C34CC5CC(C3)CC(C5)C4
| StdInChI = 1S/C26H39N3O2/c1-31-24-7-3-2-6-23(24)29-12-10-28(11-13-29)9-5-4-8-27-25(30)26-17-20-14-21(18-26)16-22(15-20)19-26/h2-3,6-7,20-22H,4-5,8-19H2,1H3,(H,27,30)
| StdInChIKey = PRZPXKIXNNNNCD-UHFFFAOYSA-N
}}
NBUMP is a highly selective 5-HT1A receptor partial agonist (Ki = 0.1 nM; IA = 40%) with an arylpiperazine structure.{{cite book | vauthors = Glennon RA | chapter = Strategies for the development of selective serotonergic agents|editor1-link=Bryan Roth | veditors = Roth BL | title = The Serotonin Receptors: From Molecular Pharmacology to Human Therapeutics (The Receptors) | publisher = Humana Press | location = Totowa, NJ | year = 2006 | isbn = 1-58829-568-0 | chapter-url = https://books.google.com/books?id=J6i6YpvCQfIC&q=NBUMP&pg=PA113 | page = 113 }} It is one of the highest affinity ligands for the 5-HT1A receptor known. It displays 460- and 260-fold selectivity for 5-HT1A over the α1-adrenergic and D2 receptors, respectively.