NESS-0327
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424803248
| IUPAC_name =
| image = NESS-0327.svg
| image_class = skin-invert-image
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 494844-07-4
| ATC_prefix =
| ATC_suffix =
| PubChem = 10435654
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII = X1BQI2J97I
| UNII_Ref = {{fdacite|changed|FDA}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8611079
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H23Cl3N4O/c25-16-7-9-18-15(13-16)5-4-6-19-22(24(32)29-30-11-2-1-3-12-30)28-31(23(18)19)21-10-8-17(26)14-20(21)27/h7-10,13-14H,1-6,11-12H2,(H,29,32)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = NCXBPZJQQSNIRA-UHFFFAOYSA-N
| chemical_formula =
| C=24 | H=23 | Cl=3 | N=4 | O=1
| smiles = Clc3cc(Cl)ccc3-n4c2-c1ccc(Cl)cc1CCCc2c(n4)C(=O)NN5CCCCC5
}}
NESS-0327 is a drug used in scientific research which acts as an extremely potent and selective antagonist of the cannabinoid receptor CB1. It is much more potent an antagonist, and more selective for the CB1 receptor over CB2, than the more commonly used ligand rimonabant, with a Ki at CB1 of 350fM (i.e. 0.00035nM) and a selectivity of over 60,000x for CB1 over CB2.{{cite journal | vauthors = Ruiu S, Pinna GA, Marchese G, Mussinu JM, Saba P, Tambaro S, Casti P, Vargiu R, Pani L | display-authors = 6 | title = Synthesis and characterization of NESS 0327: a novel putative antagonist of the CB1 cannabinoid receptor | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 306 | issue = 1 | pages = 363–70 | date = July 2003 | pmid = 12663689 | doi = 10.1124/jpet.103.049924 | s2cid = 32018707 }}
Independently, two other groups have described only modest nanomolar CB1 affinity for this compound (125nM{{cite journal | vauthors = Stoit AR, Lange JH, Hartog AP, Ronken E, Tipker K, Stuivenberg HH, Dijksman JA, Wals HC, Kruse CG | display-authors = 6 | title = Design, synthesis and biological activity of rigid cannabinoid CB1 receptor antagonists | journal = Chemical & Pharmaceutical Bulletin | volume = 50 | issue = 8 | pages = 1109–13 | date = August 2002 | pmid = 12192147 | doi = 10.1248/cpb.50.1109 | doi-access = free }} and
Also unlike rimonabant, NESS-0327 does not appear to act as an inverse agonist at higher doses, instead being a purely neutral antagonist which blocks the CB1 receptor but does not produce any physiological effect of its own.{{cite journal | vauthors = Tambaro S, Mongeau R, Dessi C, Pani L, Ruiu S | title = Modulation of ATP-mediated contractions of the rat vas deferens through presynaptic cannabinoid receptors | journal = European Journal of Pharmacology | volume = 525 | issue = 1–3 | pages = 150–3 | date = November 2005 | pmid = 16271359 | doi = 10.1016/j.ejphar.2005.09.058 }}