NNC-711

{{Chembox

| ImageFile = NO-711.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 1-(2-{[(Diphenylmethylidene)amino]oxy}ethyl)-1,2,5,6-tetrahydropyridine-3-carboxylic acid

| OtherNames = NO-711

|Section1={{Chembox Identifiers

| CASNo = 159094-94-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BGU9MZ2G30

| PubChem = 4515

| PubChem1 = 123738

| ChemSpiderID = 4358

| PubChem1_Comment = (HCl)

| SMILES = C1CN(CC(=C1)C(=O)O)CCON=C(C2=CC=CC=C2)C3=CC=CC=C3

| InChI=1S/C21H22N2O3/c24-21(25)19-12-7-13-23(16-19)14-15-26-22-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-12H,7,13-16H2,(H,24,25)

| InChIKey=NGNALWDRPKNJGR-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=21|H=22|N=2|O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

NNC-711 is an anticonvulsant, acting as a gamma-aminobutyric acid uptake inhibitor via inhibition of GAT-1.{{cite journal | pmid = 7851497 | title = Tiagabine, SK&F 89976-A, CI-966, and NNC-711 are selective for the cloned GABA transporter GAT-1| journal = European Journal of Pharmacology| volume = 269| issue = 2| pages = 219–24| year = 1994| last1 = Borden| first1 = L. A.| last2 = Murali Dhar| first2 = T. G.| last3 = Smith| first3 = K. E.| last4 = Weinshank| first4 = R. L.| last5 = Branchek| first5 = T. A.| last6 = Gluchowski| first6 = C| doi=10.1016/0922-4106(94)90089-2}}

CNS Rev:{{cite journal | vauthors=((Kubová, H.)) | journal=CNS Drug Reviews | title=NNC‐711: An Inhibitor of GAB A Uptake with Selective Affinity to GAT‐1 | volume=5 | issue=4 | pages=317–330 | date= December 1999 | doi=10.1111/j.1527-3458.1999.tb00108.x}}