NNC 63-0532

{{Short description|Chemical compound}}

{{Drugbox | verifiedrevid = 428496550

| IUPAC_name = methyl [8-(1-naphthylmethyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]dec-3-yl)acetate

| image = NNC 63-0532.svg

| width = 200

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 250685-44-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 73663SY1DT

| synonyms = NNC 63-0532

| ATC_prefix =

| ATC_suffix =

| PubChem = 9803475

| DrugBank =

| ChemSpiderID = 7979235

| C = 27 | H = 29 | N = 3 | O = 3

| smiles = c3ccccc3N(CN(C2=O)CC(=O)OC)C2(CC4)CCN4Cc5c1ccccc1ccc5

| StdInChI = 1S/C27H29N3O3/c1-33-25(31)19-29-20-30(23-11-3-2-4-12-23)27(26(29)32)14-16-28(17-15-27)18-22-10-7-9-21-8-5-6-13-24(21)22/h2-13H,14-20H2,1H3

| StdInChIKey = AQMPIDSGLFVVPL-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

NNC 63-0532 is a nociceptoid drug used in scientific research. It acts as a potent and selective agonist for the nociceptin receptor, also known as the ORL-1 (opiate receptor-like 1) receptor.{{cite journal | vauthors = Thomsen C, Hohlweg R | title = (8-Naphthalen-1-ylmethyl-4-oxo-1-phenyl-1,3,8-triaza-spiro[4. 5]dec-3-yl)-acetic acid methyl ester (NNC 63-0532) is a novel potent nociceptin receptor agonist | journal = British Journal of Pharmacology | volume = 131 | issue = 5 | pages = 903–8 | date = November 2000 | pmid = 11053209 | pmc = 1572417 | doi = 10.1038/sj.bjp.0703661 }}{{cite journal | vauthors = Guerrini R, Carra' G, Calo' G, Trapella C, Marzola E, Rizzi D, Regoli D, Salvadori S | display-authors = 6 | title = Nonpeptide/peptide chimeric ligands for the nociceptin/orphanin FQ receptor: design, synthesis and in vitro pharmacological activity | journal = The Journal of Peptide Research | volume = 63 | issue = 6 | pages = 477–84 | date = June 2004 | pmid = 15175020 | doi = 10.1111/j.1399-3011.2004.00157.x | doi-access = free }}

The function of this receptor is not well understood, but it is believed to play a role in disorders like pain, drug addiction, opioid tolerance development, and psychological disorders such as anxiety and depression. Research into the function of this receptor is an important focus of current pharmaceutical development, and selective agents such as NNC 63-0532 are essential for this work.{{cite journal | vauthors = Chiou LC, Liao YY, Fan PC, Kuo PH, Wang CH, Riemer C, Prinssen EP | title = Nociceptin/orphanin FQ peptide receptors: pharmacology and clinical implications | journal = Current Drug Targets | volume = 8 | issue = 1 | pages = 117–35 | date = January 2007 | pmid = 17266536 | doi = 10.2174/138945007779315605 }}