Namodenoson
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = Namodenoson.svg
| alt =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Investigational
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| synonyms = Chloro-IB-MECA; 2-Cl-IB-MECA
| CAS_number = 163042-96-4
| PubChem = 3035850
| UNII = Z07JR07J6C
| DrugBank = DB12885
| IUPHAR_ligand = 457
| ChEMBL = 431733
| ChemSpiderID = 2299989
| KEGG = D11128
| IUPAC_name = (2S,3S,4R,5R)-5-[2-Chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide
| StdInChI=1S/C18H18ClIN6O4/c1-21-16(29)13-11(27)12(28)17(30-13)26-7-23-10-14(24-18(19)25-15(10)26)22-6-8-3-2-4-9(20)5-8/h2-5,7,11-13,17,27-28H,6H2,1H3,(H,21,29)(H,22,24,25)/t11-,12+,13-,17+/m0/s1
| StdInChIKey = IPSYPUKKXMNCNQ-PFHKOEEOSA-N
| SMILES = CNC(=O)[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=C(N=C32)Cl)NCC4=CC(=CC=C4)I)O)O
| C = 18 | H = 18 | Cl = 1 | I = 1 | N = 6 | O = 4
}}
Namodenoson is a small molecule A3 adenosine receptor (A3AR) agonist. It is developed by Can-Fite for non-alcoholic fatty liver disease,{{cite journal |last1=Safadi |first1=Rifaat |last2=Braun |first2=Marius |last3=Francis |first3=Adi |last4=Milgrom |first4=Yael |last5=Massarwa |first5=Muhammad |last6=Hakimian |first6=David |last7=Hazou |first7=Wadi |last8=Issachar |first8=Assaf |last9=Harpaz |first9=Zivit |last10=Farbstein |first10=Motti |last11=Itzhak |first11=Inbal |last12=Lev-Cohain |first12=Naama |last13=Bareket-Samish |first13=Avital |last14=Silverman |first14=Michael H. |last15=Fishman |first15=Pnina |title=Randomised clinical trial: A phase 2 double-blind study of namodenoson in non-alcoholic fatty liver disease and steatohepatitis |journal=Alimentary Pharmacology & Therapeutics |date=December 2021 |volume=54 |issue=11–12 |pages=1405–1415 |doi=10.1111/apt.16664 |pmid=34671996 |pmc=9298378 |issn=1365-2036}} liver cancer,{{cite journal |last1=Stemmer |first1=Salomon M. |last2=Manojlovic |first2=Nebojsa S. |last3=Marinca |first3=Mihai Vasile |last4=Petrov |first4=Petar |last5=Cherciu |first5=Nelly |last6=Ganea |first6=Doina |last7=Ciuleanu |first7=Tudor Eliade |last8=Pusca |first8=Ioana Adriana |last9=Beg |first9=Muhammad Shaalan |last10=Purcell |first10=William T. |last11=Croitoru |first11=Adina-Emilia |last12=Ilieva |first12=Rumyana Nedyalkova |last13=Natošević |first13=Sladjana |last14=Nita |first14=Amedeia Lavinir |last15=Kalev |first15=Dimitar Nikolaev |last16=Harpaz |first16=Zivit |last17=Farbstein |first17=Motti |last18=Silverman |first18=Michael H. |last19=Bristol |first19=David |last20=Itzhak |first20=Inbal |last21=Fishman |first21=Pnina |title=Namodenoson in Advanced Hepatocellular Carcinoma and Child–Pugh B Cirrhosis: Randomized Placebo-Controlled Clinical Trial |journal=Cancers |date=7 January 2021 |volume=13 |issue=2 |pages=187 |doi=10.3390/cancers13020187 |pmid=33430312 |pmc=7825785 |issn=2072-6694 |doi-access=free }} and pancreatic cancer.{{cite journal |last1=Fishman |first1=Pnina |last2=Bareket-Samish |first2=Avital |last3=Itzhak |first3=Inbal |title=Effects of namodenoson on pancreatic carcinoma: Preclinical evidence. |journal=Journal of Clinical Oncology |date=1 June 2023 |volume=41 |issue=16_suppl |pages=e15134 |doi=10.1200/JCO.2023.41.16_suppl.e15134|s2cid=259081369 }}