Nandrolone nonanoate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] nonanoate

| image = Nandrolone nonanoate.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Androgen; Anabolic steroid; Androgen ester; Progestogen

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 52230-64-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2B78GY4XY5

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = 19-Nortestosterone 17β-nonanoate; Nandrolone pelargonate; 19-Nortestosterone 17β-pelargonate

| C=27 | H=42 | O=3

| SMILES = CCCCCCCCC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C

| StdInChI_Ref =

| StdInChI = 1S/C27H42O3/c1-3-4-5-6-7-8-9-26(29)30-25-15-14-24-23-12-10-19-18-20(28)11-13-21(19)22(23)16-17-27(24,25)2/h18,21-25H,3-17H2,1-2H3/t21-,22+,23+,24-,25-,27-/m0/s1

AuxInfo=1/0/N:1,30,2,3,4,5,6,7,8,18,23,17,24,14,13,27,28,20,19,21,25,26,16,15,12,9,29,22,10,11/it:im/rA:30CCCCCCCCCOOCCCCCCCCCCOCCCCCCCC/rB:s1;s2;s3;s4;s5;s6;s7;s8;d9;s9;p11;s12;s13;p14;s15;N16;s17;s18;d19;s20;d21;s21;s23;s19n24;s16s25;P26;s27;s12s15s28;P29;/rC:-11.2241,.7601,0;-9.8904,-.0099,0;-8.5567,.7601,0;-7.223,-.0099,0;-5.8893,.7601,0;-4.5557,-.0099,0;-3.222,.7601,0;-1.8883,-.0099,0;-.5546,.7601,0;-.5546,2.3001,0;.7791,-.0099,0;2.1127,.7601,0;2.2737,2.2917,0;3.7801,2.6118,0;4.5501,1.2782,0;6.0564,.958,0;7.0869,2.1024,0;8.5932,1.7822,0;9.0691,.3176,0;10.5754,-.0026,0;11.0513,-1.4672,0;12.5577,-1.7874,0;10.0209,-2.6117,0;8.5145,-2.2915,0;8.0386,-.8268,0;6.5323,-.5067,0;5.5018,-1.6511,0;3.9955,-1.3309,0;3.5196,.1337,0;2.3751,-.8967,0;

| StdInChIKey_Ref =

| StdInChIKey = UVVFTQBZOQSECA-QNTYDACNSA-N

}}

Nandrolone nonanoate, also known as nandrolone pelargonate or as 19-nortestosterone 17β-nonanoate, is an androgen and anabolic steroid and an androgen ester—specifically, the C17β nonanoate (pelargonate) ester of nandrolone (19-nortestosterone)—which was studied but was never marketed.{{cite journal | vauthors = Chaudry AQ, James KC | title = A Hansch analysis of the anabolic activities of some nandrolone esters | journal = J Med Chem | volume = 17 | issue = 2 | pages = 157–61 | date = February 1974 | pmid = 4809250 | doi = 10.1021/jm00248a003 | url = }}{{cite journal | vauthors = Chaudry MA, James KC, Ng CT, Nicholls PJ | title = Anabolic and androgenic activities, in rat, of some nandrolone and androstanolone esters | journal = J Pharm Pharmacol | volume = 28 | issue = 12 | pages = 882–5 | date = December 1976 | pmid = 12263 | doi = 10.1111/j.2042-7158.1976.tb04085.x | s2cid = 20546783 | url = }}{{cite journal | vauthors = Chaudry MA | title = Preparation and characterization some of anabolic steroids | journal = Journal of Pharmacy (Lahore) | volume = 4 | issue = 1–2 | pages = 13–17 | year = 1983 | issn = 0253-8288 | language = English | url = | quote = Butyrate, hexanoate, heptanoate, octanoate, nonanoate, decanoate, and undecanoate esters of testosterone and nandrolone were prepd. and characterized.}}{{cite journal | vauthors = Chaudry MA | title = A realistic method for the evaluation of anabolic androgenic activity of some nandrolone esters | journal = Journal of Pharmacy (Lahore) | volume = 4 | issue = 1–2 | pages = 51–62 | year = 1983 | issn = 0253-8288 | language = English | url = | quote = The short-comings of the various methods used for detg. anabolic-androgenic activities were discussed, and a realistic method was developed for the comparative studies. The limitation of using the wt. gain of the target organs after administration of the hormone, which is time-dependent, was highlighted. The cumulative wt. (mg day) was recommended; it is independent of time, provided the expt. is carried out until the sample response reaches a plateau. This method provides a basis for obtaining anabolic-androgenic percentage dissocn. The method is applied to a no. of nandrolone esters.}}{{cite journal | vauthors = Ruelle P, Farina-Cuendet A, Kesselring UW | title = The mobile order solubility equation applied to polyfunctional molecules: The non-hydroxysteroids in aqueous and non aqueous solvents | journal = Int J Pharm | volume = 157 | issue = 2 | pages = 219–232 | date = November 1997 | pmid = 10477819 | doi = 10.1016/s0378-5173(97)00240-8 | url = }}{{cite book|author=Joseph R. Robinson|title=Sustained and Controlled Release Drug Delivery Systems|url=https://books.google.com/books?id=txptAAAAMAAJ|year=1978|publisher=M. Dekker|isbn=978-0-8247-6715-0|page=428}}{{cite journal | vauthors = Chien YW | title = Long-acting parenteral drug formulations | journal = J Parenter Sci Technol | volume = 35 | issue = 3 | pages = 106–139 | date = 1981 | pmid = 6113276 | doi = | url = https://journal.pda.org/content/35/3/106.short}}