Naphthol AS
{{Chembox
| ImageFile = Naphthol AS.svg
| ImageSize =
| ImageAlt =
| PIN = 3-Hydroxy-N-phenylnaphthalene-2-carboxamide
| OtherNames = Naphtol AS, 3-hydroxy-2-naphthanilide, β-Hydroxynaphthoic anilide
|Section1={{Chembox Identifiers
| CASNo = 92-77-3
| PubChem = 66719
| ChemSpiderID = 60085
| EC_number = 202-188-1
| UNII = V3ZU6E76NB
| InChI = 1S/C17H13NO2/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14/h1-11,19H,(H,18,20)
| InChIKey = JFGQHAHJWJBOPD-UHFFFAOYSA-N
| SMILES = C1=CC=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2O }}
|Section2={{Chembox Properties
| C=17|H=13|N=1|O=2
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHSPictograms = {{GHS07}} {{GHS09}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|302|315|317|319|332|335|411}}
| PPhrases = {{P-phrases|261|264|270|271|272|273|280|301+312|302+352|304+312|304+340|305+351+338|312|321|330|332+313|333+313|337+313|362|363|391|403+233|405|501}}
}}
}}
Naphthol AS is an organic compound with the formula C10H6(OH)C(O)NHC6H5. It is the anilide of 3-hydroxy-2-carboxynaphthalene. Many analogous compounds are known, designated with a differing suffix. For example, in Naphthol AS-OL, the aryl substituent on nitrogen is C6H4-2-OCH3. These compounds are used as coupling partners in the preparation of some azo dyes.{{cite encyclopedia|author1=K. Hunger|author2=W. Herbst|title=Pigments, Organic|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|place=Weinheim|year=2012|doi=10.1002/14356007.a20_371|isbn=978-3527306732}}
History
In 1911, it was found to be a good precursor to dyes for wool by chemists at K. Oehler Anilin- und Anilinfarbenfabrik Offenbach.{{cite book|author=Willy Herbst, Klaus Hunger|title=Industrielle Organische Pigmente Herstellung, Eigenschaften, Anwendung|url=https://books.google.com/books?id=zP0JXdYsWP0C&pg=PA201|year=2009 |edition=3. |publisher=Wiley VCH |isbn=978-3-527-62496-6|pages=201}}{{Patent
| Land = DE
| V-Nr = 261594
| Typ = Erteilung
| Titel = Verfahren zur Darstellung von Monoazofarbstoffen
| A-Datum = 1912-05-18
| V-Datum = 1913-06-27
| Erfinder =
| Anmelder =
}}