Naphthol AS

{{Chembox

| ImageFile = Naphthol AS.svg

| ImageSize =

| ImageAlt =

| PIN = 3-Hydroxy-N-phenylnaphthalene-2-carboxamide

| OtherNames = Naphtol AS, 3-hydroxy-2-naphthanilide, β-Hydroxynaphthoic anilide

|Section1={{Chembox Identifiers

| CASNo = 92-77-3

| PubChem = 66719

| ChemSpiderID = 60085

| EC_number = 202-188-1

| UNII = V3ZU6E76NB

| InChI = 1S/C17H13NO2/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14/h1-11,19H,(H,18,20)

| InChIKey = JFGQHAHJWJBOPD-UHFFFAOYSA-N

| SMILES = C1=CC=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2O }}

|Section2={{Chembox Properties

| C=17|H=13|N=1|O=2

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHSPictograms = {{GHS07}} {{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|315|317|319|332|335|411}}

| PPhrases = {{P-phrases|261|264|270|271|272|273|280|301+312|302+352|304+312|304+340|305+351+338|312|321|330|332+313|333+313|337+313|362|363|391|403+233|405|501}}

}}

}}

Naphthol AS is an organic compound with the formula C10H6(OH)C(O)NHC6H5. It is the anilide of 3-hydroxy-2-carboxynaphthalene. Many analogous compounds are known, designated with a differing suffix. For example, in Naphthol AS-OL, the aryl substituent on nitrogen is C6H4-2-OCH3. These compounds are used as coupling partners in the preparation of some azo dyes.{{cite encyclopedia|author1=K. Hunger|author2=W. Herbst|title=Pigments, Organic|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|place=Weinheim|year=2012|doi=10.1002/14356007.a20_371|isbn=978-3527306732}}

History

In 1911, it was found to be a good precursor to dyes for wool by chemists at K. Oehler Anilin- und Anilinfarbenfabrik Offenbach.{{cite book|author=Willy Herbst, Klaus Hunger|title=Industrielle Organische Pigmente Herstellung, Eigenschaften, Anwendung|url=https://books.google.com/books?id=zP0JXdYsWP0C&pg=PA201|year=2009 |edition=3. |publisher=Wiley VCH |isbn=978-3-527-62496-6|pages=201}}{{Patent

| Land = DE

| V-Nr = 261594

| Typ = Erteilung

| Titel = Verfahren zur Darstellung von Monoazofarbstoffen

| A-Datum = 1912-05-18

| V-Datum = 1913-06-27

| Erfinder =

| Anmelder =

}}

References