Napropamide

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{chembox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| Name = Napropamide

| ImageFile = Napropamide.svg

| ImageSize = 200px

| ImageName = Skeletal formula of napropamide

| ImageFile1 =

| ImageSize1 = 200px

| ImageName1 =

| PIN = N,N-Diethyl-2-naphthalen-1-yloxypropanamide

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 15299-99-7

| CASNo_Ref =

| Beilstein = 2217870

| IUPHAR_ligand =

| ChEBI = 83771

| ChemSpiderID = 25304

| KEGG = C18868

| PubChem = 27189

| ChEMBL_Ref =

| ChEMBL = 1877460

| EINECS = 239-333-3

| UNII = B56M9401K6

| StdInChI = InChI=1S/C17H21NO2/c1-4-18(5-2)17(19)13(3)20-16-12-8-10-14-9-6-7-11-15(14)16/h6-13H,4-5H2,1-3H3

| StdInChIKey = WXZVAROIGSFCFJ-UHFFFAOYSA-N

| SMILES = CCN(CC)C(=O)C(C)OC1=CC=CC2=CC=CC=C21

}}

| Section2 = {{Chembox Properties

| C=17 | H=21 | N=1 | O=2

| Appearance =

| Odor =

| Density =

| Solubility =

| SolubleOther =

| MeltingPtC =

| MeltingPt_ref =

| BoilingPtC =

| BoilingPt_ref =

| Viscosity =

| VaporPressure =

| ThermalConductivity =

| LogP =

| pKa =

| RefractIndex =

}}

| Section3 = {{Chembox Thermochemistry

| DeltaHc =

| HeatCapacity =

| DeltaHf =

}}

| Section4 = {{Chembox Hazards

| ExternalSDS =

| MainHazards =

| FlashPtC =

| FlashPt_ref =

| NFPA_ref =

| LD50 =

}}

}}

Napropamide is an acetamide chemical herbicide. Its formula is {{chem2|C17H21NO2}}. It is sold under the trade name of Devrinol,{{Cite web|url=https://content.ces.ncsu.edu/devrinol-napropamide |title=Devrinol (napropamide) |first=Joe |last=Neal |date= November 18, 2014 |website=NC State Extension |access-date=November 26, 2024}} and was first manufactured in 1969.{{Citation |last=Wendeborn |first=S. |title=1.8 Chirality in Agrochemicals |date=2012 |work=Comprehensive Chirality |pages=120–166 |url=https://linkinghub.elsevier.com/retrieve/pii/B9780080951676001026 |access-date=2024-11-26 |publisher=Elsevier |language=en |doi=10.1016/b978-0-08-095167-6.00102-6 |isbn=978-0-08-095168-3 |last2=Godineau |first2=E. |last3=Mondière |first3=R. |last4=Smejkal |first4=T. |last5=Smits |first5=H.|url-access=subscription }}

"Devrinol 50" is a wettable powder containing 50% napropamide.{{cite journal |last1=Williams |first1=H.h. |title=Effects of certain preemergence herbicides on Diochondra spp. |journal=Proceedings of the Second International Turfgrass Research Conference |date=1974 |pages=410–417 |doi=10.2135/1974.proc2ndintlturfgrass.c60}}