Narasin

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 444434623

| IUPAC_name = (2R)-2-[(2R,3S,5S,6R)-6-[(1S,2S,3S,5R)-5- [(2S,5S,7R,9S,10S,12R,15R)-2-[(2R,5R,6S)-5-ethyl-5-hydroxy-6-methyl-2-tetrahydropyranyl]-15-hydroxy-2,10,12-trimethyl-1,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-9-yl]-2-hydroxy-1,3-dimethyl-4-oxoheptyl]-3,5-dimethyl-2-tetrahydropyranyl]butanoic acid

| image = narasin.png

| tradename =

| Drugs.com = {{drugs.com|international|narasin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 55134-13-9

| ATCvet = yes

| ATC_prefix = P51

| ATC_suffix = BB04

| ATC_supplemental = {{ATCvet|P51|BB54}}

| PubChem = 65452

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 58911

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DZY9VU539P

| synonyms = (4S)-4-methyl-salinomycin

| chemical_formula =

| C=43 | H=72 | O=11

| smiles = O=C([C@@H](C)[C@@H](O)[C@H](C)[C@]5([H])O[C@]([C@@H](CC)C(O)=O)([H])[C@@H](C)C[C@@H]5C)[C@H](CC)[C@@]1([H])O[C@@]2(O[C@@]3(CC[C@]([C@]4([H])O[C@@H](C)[C@@](O)(CC)CC4)(C)O3)[C@H](O)C=C2)[C@H](C)C[C@@H]1C

| StdInChI=1S/C43H72O11/c1-12-30(35(46)27(8)34(45)28(9)36-23(4)21-24(5)37(51-36)31(13-2)39(47)48)38-25(6)22-26(7)42(52-38)18-15-32(44)43(54-42)20-19-40(11,53-43)33-16-17-41(49,14-3)29(10)50-33/h15,18,23-34,36-38,44-45,49H,12-14,16-17,19-22H2,1-11H3,(H,47,48)/t23-,24-,25-,26+,27-,28-,29-,30-,31+,32+,33+,34+,36+,37+,38-,40-,41+,42-,43-/m0/s1

| StdInChIKey = VHKXXVVRRDYCIK-CWCPJSEDSA-N

}}

Narasin is a coccidiostat and antibacterial agent.{{cite journal | vauthors = Gerhold RW, Fuller AL, Lollis L, Parr C, McDougald LR | title = The efficacy of anticoccidial products against Eimeria spp. in northern bobwhites | journal = Avian Diseases | volume = 55 | issue = 1 | pages = 59–64 | date = March 2011 | pmid = 21500637 | doi = 10.1637/9572-101310-Reg.1 | s2cid = 30943649 }}{{cite journal | vauthors = Fitzgerald PR, Mansfield ME | title = Effects of inoculations with Eimeria zuernii on young calves treated with decoquinate or narasin with or without dexamethasone | journal = American Journal of Veterinary Research | volume = 50 | issue = 7 | pages = 1056–1059 | date = July 1989 | pmid = 2774323 }} It is a derivative of salinomycin with an additional methyl group. Narasin is produced by fermentation of a strain of Streptomyces aureofaciens.{{cite book | vauthors = Anadón A, Martínez-Larrañaga MR |title=Encyclopedia of Food Safety |chapter=Veterinary Drugs Residues: Coccidiostats |date=2014 |pages=63–75 |doi=10.1016/B978-0-12-378612-8.00246-8|isbn=9780123786135 }}

References