Neltenexine
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 444135566
| IUPAC_name = N-(2,4-dibromo-6-
| image = Neltenexine.png
| tradename = Alveoten
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 99453-84-6
| ATC_prefix = R05
| ATC_suffix = CB14
| PubChem = 3047787
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16736685
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U942DGM90X
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07382
| C=18 | H=20 | Br=2 | N=2 | O=2 | S=1
| smiles = O=C(Nc2c(CN[C@@H]1CC[C@@H](O)CC1)cc(Br)cc2Br)c3cccs3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H20Br2N2O2S/c19-12-8-11(10-21-13-3-5-14(23)6-4-13)17(15(20)9-12)22-18(24)16-2-1-7-25-16/h1-2,7-9,13-14,21,23H,3-6,10H2,(H,22,24)/t13-,14-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SSLHKNBKUBAHJY-HDJSIYSDSA-N
}}
Neltenexine (trade name Alveoten) is a mucolytic.{{cite journal | vauthors = Fadda G | title = Oral neltenexine in patients with obstructive airways diseases: an open, randomised, controlled comparison versus sobrerol | journal = Minerva Medica | volume = 92 | issue = 4 | pages = 269–75 | date = August 2001 | pmid = 11535970 }}
References
{{reflist}}
{{Cough and cold preparations}}
{{respiratory-system-drug-stub}}