Neothiobinupharidine

{{more citations needed|date=May 2022}}

{{Chembox

| ImageFile = Neothiobinupharidine.svg

| ImageAlt =

| PIN = (2′R,3′′R,6S,6′′S,9R,9′′R,9aS,9′′aS)-6,6′′-Di(furan-3-yl)-9,9′′-dimethyldodecahydro-2H,2′′H,4H,4′′H-dispiro[quinolizine-3,2′-thiolane-4′,3′′-quinolizine]

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 4850-09-3

| CASNo1 = 30343-72-7

| CASNo_Ref = {{Cascite|changed|??}}

| CASNo1_Ref = {{Cascite|changed|CAS}}

| ChEBI = 9548

| ChEMBL = 138622

| KEGG = C09990

| PubChem = 12313251

| ChemSpiderID = 23215070

| SMILES = C[C@@H]1CC[C@H](N2[C@H]1CC[C@]3(C2)C[C@@]4(CC[C@H]5[C@@H](CC[C@H](N5C4)c6ccoc6)C)SC3)c7ccoc7

| StdInChI = 1S/C30H42N2O2S/c1-21-3-5-27(23-9-13-33-15-23)31-18-29(11-7-25(21)31)17-30(35-20-29)12-8-26-22(2)4-6-28(32(26)19-30)24-10-14-34-16-24/h9-10,13-16,21-22,25-28H,3-8,11-12,17-20H2,1-2H3/t21-,22-,25+,26+,27+,28+,29-,30-/m1/s1

| StdInChIKey = WBMOHCBEBDKSBI-GUUMEGLWSA-N }}

|Section2={{Chembox Properties

| C=30 | H=42 | N=2 | O=2 | S=1

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Neothiobinupharidine is a dimeric thiaspirane alkaloid isolated from the dwarf water lily Nuphar pumila. It exhibits weak immunosuppressive and cytotoxic bioactivity in cell line experiments.{{cite journal |title=Biofunctional Effects of Thiohemiaminal-Type Dimeric Sesquiterpene Alkaloids from Nuphar Plants |journal=Chem. Pharm. Bull. |year=2019 |volume=67 |pages=666–674 |doi=10.1248/cpb.c18-01030 |pmid=31257322 |last1=Matsuda |first1=Hisashi |last2=Nakamura |first2=Seikou |last3=Nakashima |first3=Souichi |last4=Fukaya |first4=Masashi |last5=Yoshikawa |first5=Masayuki |issue=7 |s2cid=195758107 |doi-access=free }}

References