New methylene blue

{{Short description|A substance used as a blue dye or stain and as a medication}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 442336972

| Name = New methylene blue

| ImageFile = New methylene blue structure.svg

| ImageFile1 =

| ImageSize1 = 300px

| Section1 = {{Chembox Identifiers

| InChI = 1/C18H22N3S.ClH/c1-5-19-13-9-17-15(7-11(13)3)21-16-8-12(4)14(20-6-2)10-18(16)22-17;/h7-10,19-20H,5-6H2,1-4H3;1H/q+1;/p-1

| InChIKey = NZYCYASKVWSANA-REWHXWOFAR

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H22N3S.ClH/c1-5-19-13-9-17-15(7-11(13)3)21-16-8-12(4)14(20-6-2)10-18(16)22-17;/h7-10,19-20H,5-6H2,1-4H3;1H/q+1;/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NZYCYASKVWSANA-UHFFFAOYSA-M

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1934-16-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5GCZ112BCN

| PubChem = 73518

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID =16736255

| SMILES = [Cl-].Cc1cc2nc3cc(C)c(cc3[s+]c2cc1NCC)NCC

}}

| Section2 = {{Chembox Properties

| Formula = C18H22N3S:SCl ZnCl2

| MolarMass = 484.22 g/mol

| Density =

| MeltingPtC = 239

| BoilingPt = Decomposes

}}

| Section3 = {{Chembox Hazards

| GHSPictograms = {{GHS exclamation mark}}

| GHSSignalWord = WARNING

| HPhrases = {{H-phrases|302|312|332}}

| PPhrases = {{P-phrases|261|264|270|271|280|301+317|302+352|304+340|317|321|330|362+364|501}}

}}

}}

{{clarification needed span|New methylene blue (also NMB)|Why is the substance called "'New' methylene blue"? What is "new" about it? How was it given that name? How does it differ from the original "Methylene blue"? None of this is addressed anywhere in the article.|date=December 2022}} is an organic compound of the thiazine class of heterocycles. It is used as a stain and as an antimicrobial agent. It is classified as an azine dye, and the chromophore is a cation, the anion is often unspecified.Vennerstrom, Jonathan L.; Makler, Michael T.; Angerhofer, Cidy K.; Williams, Jean A. "Antimalarial dyes revisited: xanthenes, azines, oxazines, and thiazine" Antimicrobial Agents and Chemotherapy (1995), 39(12), 2671–7. {{doi|10.1128/AAC.39.12.2671}}.

Applications

NMB is a staining agent used in diagnostic cytopathology and histopathology, typically for staining immature red blood cells. It is a supravital stain.{{cite web|url=http://wps.prenhall.com/wps/media/objects/684/700987/ch07RET.pdf|title=Reticulocyte Count|publisher=Prentice-Hall}} It is closely related to methylene blue, an older stain in wide use.

Safety

New methylene blue is toxic. Skin contact or inhalation should be avoided.

See also

References