Nifenalol

{{Chembox

| ImageFile = Nifenalol.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 1-(4-Nitrophenyl)-2-(propan-2-ylamino)ethanol

| OtherNames = Isophenethanol

|Section1={{Chembox Identifiers

| CASNo = 7413-36-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D1DE63830P

| PubChem = 6317

| ChemSpiderID = 6078

| InChI=1S/C11H16N2O3/c1-8(2)12-7-11(14)9-3-5-10(6-4-9)13(15)16/h3-6,8,11-12,14H,7H2,1-2H3

| InChIKey= UAORFCGRZIGNCI-UHFFFAOYSA-N

| SMILES = CC(C)NCC(C1=CC=C(C=C1)[N+](=O)[O-])O}}

|Section2={{Chembox Properties

| C=11 | H=16 | N=2 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Nifenalol is a beta-adrenoceptor antagonist.{{cite journal|pmid=8896710|year=1996|last1=Lemmens-Gruber|first1=R|last2=Zilberszac|first2=A|last3=Heistracher|first3=P|title=Arrhythmogenic effect of beta-adrenoceptor-blocking drugs in Purkinje fibres of guinea-pig hearts|volume=331|issue=1|pages=46–58|journal=Archives Internationales de Pharmacodynamie et de Thérapie}}