Nitroacetanilide

{{refimprove|date=March 2015}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424674028

| Reference =

| Name = 4-Nitroacetanilide

| ImageFile = 4-Nitroacetanilide.svg

| PIN = N-(4-Nitrophenyl)acetamide

| OtherNames = p-Acetamidonitrobenzene; p-Nitroacetanilide; N-Acetyl-4-nitroaniline

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 104-04-1

| ChEMBL = 131469

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = PH3B066365

| RTECS =

| EINECS = 203-169-0

| UNNumber =

| PubChem = 7691

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7407

| SMILES = O=C(Nc1ccc(cc1)[N+]([O-])=O)C

| InChI = 1/C8H8N2O3/c1-6(11)9-7-2-4-8(5-3-7)10(12)13/h2-5H,1H3,(H,9,11)

| InChIKey = NQRLPDFELNCFHW-UHFFFAOYAB

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C8H8N2O3/c1-6(11)9-7-2-4-8(5-3-7)10(12)13/h2-5H,1H3,(H,9,11)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NQRLPDFELNCFHW-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| Formula = C₈H₈N₂O₃

| MolarMass = 180.16 g/mol

| Appearance = Solid, white-green or brown

| Density = 1.34 g/cm³

| Solubility =

| MeltingPtC = 215

| BoilingPtC = 408.9

| Viscosity =

| pKa =

}}

| Section3 =

| Section4 =

| Section5 =

| Section6 =

| Section7 = {{Chembox Hazards

| MainHazards = Irritant

| ExternalSDS =

| FlashPt =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| Hazards_ref={{cite web |title=N-(4-Nitrophenyl)acetamide (compound) |url=https://pubchem.ncbi.nlm.nih.gov/compound/7691#section=Safety-and-Hazards |access-date=5 December 2021}}

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|332+313|337+313|362|403+233|405|501}}

}}

| Section8 = {{Chembox Related

| OtherFunction_label =

| OtherFunction =

| OtherCompounds =

}}

}}

File:Deacylation of Nitroacetanilide.jpg

4-Nitroacetanilide is a chemical compound which is a nitro derivative of acetanilide. There are two other isomers of nitroacetanilide, 2-nitroacetanilide and 3-nitroacetanilide.

4-Nitroacetanilide is used as in intermediate in the production of some dyes."Dyes and Dye Intermediates" in Kirk‑Othmer Encyclopedia of Chemical Technology, Peter Gregory, {{doi|10.1002/0471238961.0425051907180507.a01}}