Nitromethaqualone

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-methyl-3-(2-methoxy-4-nitrophenyl)-4(3H)-quinazolinone

| image = Nitromethaqualone.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 340-52-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7G855468ZM

| ATC_prefix = none

| ATC_suffix =

| PubChem = 63339

| DrugBank =

| ChemSpiderID = 57006

| C=16 | H=13 | N=3 | O=4

| smiles = O=C1C2=CC=CC=C2N=C(N1C3=C(OC)C=C(N(=O)=O)C=C3)C

}}

Nitromethaqualone{{ cite patent | country = US | number = 3162634 | status = patent | gdate = 1964-12-22 | title = 2-Methyl-3-(2'-methyl-3'-chlorphenyl)-quinazolone-(4) | inventor = Klosa J (Berlin, Germany) }} is an analogue of methaqualone that has similar sedative and hypnotic properties.{{cite journal | vauthors = Szirmai A | title = [Pharmacological and Therapeutic Studies with a New Quinazolone Derivative, Nitromethaqualone] | language = German | journal = Therapeutische Umschau. Revue Therapeutique | volume = 20 | pages = 542–6 | date = November 1963 | pmid = 14101319 }}

It is significantly more potent (10×) compared to the parent compound; the typical dose is approximately 25 mg.{{medcn|date=January 2024}}