Nitrotriazolone

{{chembox

| Reference = {{cite web|title=Nitrotriazolone|url=https://pubchem.ncbi.nlm.nih.gov/compound/3453883#section=Chemical-and-Physical-Properties|website=PubChem|publisher=National Institutes of Health|accessdate=16 November 2016|archive-date=17 November 2016|archive-url=https://web.archive.org/web/20161117062959/https://pubchem.ncbi.nlm.nih.gov/compound/3453883#section=Chemical-and-Physical-Properties|url-status=live}}

| PIN = 5-nitro-1,2-dihydro-3H-1,2,4-triazol-3-one

| OtherNames =

| ImageFile = Nitrotriazolone.svg

| Section1 = {{Chembox Identifiers

| Abbreviations = NTO

| InChI1 = 1S/C2H2N4O3/c7-2-3-1(4-5-2)6(8)9/h(H2,3,4,5,7)

| InChIKey1 = QJTIRVUEVSKJTK-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 932-64-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 43WPQ5QCE3

| UNNumber = 0490

| EINECS = 213-254-4

| SMILES = C1(=NC(=O)NN1)[N+](=O)[O-]

| PubChem = 3453883

| ChemSpiderID = 2696109

| MeSHName = C420648

}}

| Section2 = {{Chembox Properties

| C=2 | H=2 | N=4 | O=3

| Appearance = Off white, yellowish beige color to light yellow powder, crystals, or prills

| Odor = Odourless

| Density = 1.9 g/cm³ (20 °C)

| MeltingPtC = 268-271

| BoilingPtC =

| Solubility = 17,200 mg/L

| SolubleOther = Soluble in acetone, ethyl acetate
Slightly soluble in dichloromethane

| LogP = −1.699 (22 °C)

| Solvent =

| pKa =3.76 (20 °C)

| pKb =

| VaporPressure =

| AtmosphericOHRateConstant =

}}

| Section3 = {{Chembox Explosive

| ShockSens = Very low

| FrictionSens = Very low

| DetonationV = 8,500 m/s

| REFactor =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc = −934.4 kJ/mol

| DeltaHf =

| Entropy =

| HeatCapacity = 124.5 J/K at (47 °C)

}}

| Section5 = {{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

| Section6 = {{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-I =

| NFPA-S =

| ExternalSDS =

| GHSPictograms = {{GHS01}} {{GHS02}} {{GHS07}} {{GHS08}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|209|223|242|301|313|315|319|333|335}}

| PPhrases = {{P-phrases|280|270|262|260|220|210}}

| FlashPt =

| ExploLimits =

| LD50 =

| PEL =

}}

| Section8 = {{Chembox Related

| OtherCompounds =

}}

}}

Nitrotriazolone (NTO) is a heterocyclic semicarbazide-derived high explosive first identified in 1905, but research into its explosive properties was not conducted until the 1980s.{{cite book|author=Jai Prakash Agrawal|title=High Energy Materials: Propellants, Explosives and Pyrotechnics|url=https://books.google.com/books?id=z25cCwAAQBAJ&pg=PA124|date=20 November 2015|publisher=Wiley |isbn=978-3-527-80268-5|pages=124–|access-date=20 August 2019|archive-date=25 January 2021|archive-url=https://web.archive.org/web/20210125142438/https://books.google.com/books?id=z25cCwAAQBAJ&pg=PA124|url-status=live}} NTO is currently being used by the US Army in munitions, specifically Insensitive munitions replacing those made with legacy explosives.{{cite web|last1=Winstead|first1=Bob |title=Nitrotriazolone: An Environmental Odyssey|url=http://www.dtic.mil/ndia/2011system/13232_WinsteadWednesday.pdf|publisher=NDIA Systems Engineering Conference|accessdate=16 November 2016|date=26 October 2011|archive-date=13 December 2016|archive-url=https://web.archive.org/web/20161213182049/http://www.dtic.mil/ndia/2011system/13232_WinsteadWednesday.pdf|url-status=dead}}

Nitrotriazolone is getting progressively adopted in novel explosive formulations, such as IMX-101, a new, safer alternative to TNT specially devised in 2010 by BAE Systems, where it is combined with 2,4-dinitroanisole (DNAN) and nitroguanidine. As such, NTO is found in the vast majority of IMX formulations. The Picatinny Arsenal has also adopted the implementation of NTO and DNAN in many of their likewise newly developed insensitive explosive mixtures, which share many of the same applications of the IMXs. {{cite book|author= Shree Nath Singh|title=Biological Remediation of Explosive Residues|url=https://books.google.com/books?id=5EnABAAAQBAJ&pg=PA285|date=4 August 2013 |publisher=Springer Science & Business Media|isbn=978-3-319-01083-0|pages=285–|access-date=20 August 2019|archive-date=25 January 2021|archive-url= https://web.archive.org/web/20210125142454/https://books.google.com/books?id=5EnABAAAQBAJ&pg=PA285|url-status=live}}