Nitroxazepine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 10-[3-(dimethylamino)propyl]-2-nitrodibenzo[b,f][1,4]oxazepin-11(10H)-one

| image = Nitroxazepine.png

| alt = Chemical structure of Nitroxazepine

| tradename = Sintamil

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 16398-39-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CNU9GY55SI

| ATC_prefix = none

| ATC_suffix =

| PubChem = 27857

| ChemSpiderID = 25919

| ChEBI = 135448

| C=18 | H=19 | N=3 | O=4

| SMILES = [O-][N+](=O)c2ccc1Oc3c(N(C(=O)c1c2)CCCN(C)C)cccc3

| StdInChI = 1S/C18H19N3O4/c1-19(2)10-5-11-20-15-6-3-4-7-17(15)25-16-9-8-13(21(23)24)12-14(16)18(20)22/h3-4,6-9,12H,5,10-11H2,1-2H3

| StdInChIKey = CGYWLLGTCBIGSR-UHFFFAOYSA-N

}}

Nitroxazepine (brand name Sintamil) is a tricyclic antidepressant (TCA) which was introduced by Ciba-Geigy (now Novartis) for the treatment of depression in India in 1982.{{cite book | title = Progress in Medicinal Chemistry, Volume 22 (v. 22) | publisher = Elsevier Science Publishing Company | year = 1985 | page = 246 | isbn = 0-444-80668-7 | url = https://books.google.com/books?id=rsdcJ3fSNy4C&pg=PA246 }} It is also indicated for the treatment of nocturnal enuresis. Nitroxazepine acts as a serotonin-norepinephrine reuptake inhibitor and has similar effects to imipramine, but with certain advantages, such as lower anticholinergic side effects.{{cite book | title = Progress in Medicinal Chemistry, Volume 23 (v. 23) | publisher = Not Avail | year = 2000 | page = 136 | isbn = 0-444-80802-7 | url = https://books.google.com/books?id=gmhcIEQ2UzIC&pg=PA136 }}{{cite book | title = Ann Reports Medicinal Chem V11 (v. 11) | publisher = Academic Press Inc | location = Boston | year = 1976 | page = 4 | isbn = 0-12-040511-3 | url = https://books.google.com/books?id=mr1DoZAz0MoC&pg=PA4 }}{{cite journal |vauthors=Johnson O, Jones DW, Nagarajan K, Bhadbhade MM, Venkatesan K | title = X-ray crystal structure analysis of nitroxazepine: 10-(3-dimethylaminopropyl)-2-nitro-10,11-dihydrodibenz [b,f][l,4]oxazepin-11-one | journal = Journal of Chemical Crystallography | volume = 22 | issue = 5 | pages = 579–583 | year = 1992 | doi = 10.1007/BF01161343 | s2cid = 96236391 }}