Norcantharidin

{{Chembox

| ImageFile = Norcantharidin.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames = Endothall anhydride; 3,6-Endoxohexahydrophthalic anhydride

|Section1={{Chembox Identifiers

| CASNo = 5442-12-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8452E71EO7

| ChEMBL = 1237212

| PubChem = 9877482

| ChemSpiderID = 8053159

| SMILES = C1C[C@H]2[C@H]3[C@@H]([C@@H]1O2)C(=O)OC3=O

| StdInChI = 1S/C8H8O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h3-6H,1-2H2/t3-,4+,5-,6+

| StdInChIKey = JAABVEXCGCXWRR-FBXFSONDSA-N}}

|Section2={{Chembox Properties

| C =8| H=8|O=4

| Appearance = white, solid

| Density =

| MeltingPtC = 115

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards = Xi

| FlashPt =

| AutoignitionPt =

}}

}}

Norcantharidin is a synthetic anticancer compound.{{cite journal|pmid=23935664|year=2013|last1=Lv|first1=H|last2=Li|first2=Y|last3=Du|first3=H|last4=Fang|first4=J|last5=Song|first5=X|last6=Zhang|first6=J|title=The Synthetic Compound Norcantharidin Induced Apoptosis in Mantle Cell Lymphoma in Vivo and in Vitro through the PI3K-Akt-NF- κ B Signaling Pathway|volume=2013|pages=461487|doi=10.1155/2013/461487|pmc=3722980|journal=Evidence-Based Complementary and Alternative Medicine|doi-access=free}}