Nothofagin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451950115

| ImageFile = Nothofagin structure.svg

| ImageSize = 200px

| IUPACName = 2',4,4',6'-Tetrahydroxy-3-C-β-D-glucopyranosyldihydrochalcone

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 11023-94-2

| PubChem = 21722188

| ChEMBL = 4082869

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10306387

| SMILES = O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@@H]1CO)c3c(O)cc(O)c(C(=O)CCc2ccc(O)cc2)c3O

| InChI = 1/C21H24O10/c22-8-14-17(27)19(29)20(30)21(31-14)16-13(26)7-12(25)15(18(16)28)11(24)6-3-9-1-4-10(23)5-2-9/h1-2,4-5,7,14,17,19-23,25-30H,3,6,8H2/t14-,17-,19+,20-,21+/m1/s1

| InChIKey = VZBPTZZTCBNBOZ-VJXVFPJBBW

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H24O10/c22-8-14-17(27)19(29)20(30)21(31-14)16-13(26)7-12(25)15(18(16)28)11(24)6-3-9-1-4-10(23)5-2-9/h1-2,4-5,7,14,17,19-23,25-30H,3,6,8H2/t14-,17-,19+,20-,21+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VZBPTZZTCBNBOZ-VJXVFPJBSA-N

}}

|Section2={{Chembox Properties

| C=21 | H=24 | O=10

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

Nothofagin is a dihydrochalcone. It is a C-linked phloretin glucoside found in rooibos (Aspalathus linearis){{cite journal |vauthors=Bramati L, etal | title = Quantitative Characterization of Flavonoid Compounds in Rooibos Tea (Aspalathus Linearis) by LC-UV/DAD

| journal = Journal of Agricultural and Food Chemistry

| volume = 50

| pages = 5513–5519

| publisher = Elsevier

| year = 2002

| doi = 10.1021/jf025697h | pmid = 12236672 | issue = 20}}

and New Zealand red beech (Nothofagus fusca).{{cite journal

| vauthors = Hillis W, Inoue T

| title = The polyphenols of Nothofagus species - II. The heartwood of Nothofagus fusca

| journal = Phytochemistry

| volume = 6

| pages = 59–67