O-1602

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 5-methyl-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol

| image = O-1602_structure.png

| image_class = skin-invert-image

| width = 220

| tradename =

| IUPHAR_ligand = 5525

| CAS_number = 317321-41-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 59F4R2N5N5

| PubChem = 45073499

| ChemSpiderID = 23014383

| C=17 | H=22 | O=2

| smiles = CC1=C[C@@H](C2=C(C)C=C(O)C=C2O)[C@H](C(C)=C)CC1

| StdInChI = 1S/C17H22O2/c1-10(2)14-6-5-11(3)7-15(14)17-12(4)8-13(18)9-16(17)19/h7-9,14-15,18-19H,1,5-6H2,2-4H3/t14-,15+/m0/s1

| StdInChIKey = KDZOUSULXZNDJH-LSDHHAIUSA-N

}}

O-1602 is a synthetic compound most closely related to abnormal cannabidiol, and more distantly related in structure to cannabinoid drugs such as THC. O-1602 does not bind to the classical cannabinoid receptors CB1 or CB2 with any significant affinity, but instead is an agonist at several other receptors which appear to be related to the cannabinoid receptors, particularly GPR18 and GPR55. These previously orphan receptors have been found to be targets for a number of endogenous and synthetic cannabinoid compounds, and are thought to be responsible for most of the non-CB1, non-CB2 mediated effects that have become evident in the course of cannabinoid research. O-1602 produces some effects shared with classical cannabinoid compounds such as analgesic and antiinflammatory effects and appetite stimulation, but it does not produce sedation or psychoactive effects, and has several actions in the gut and brain that are not shared with typical cannabinoid agonists.{{cite journal | vauthors = Ashton JC | title = The atypical cannabinoid O-1602: targets, actions, and the central nervous system | journal = Central Nervous System Agents in Medicinal Chemistry | volume = 12 | issue = 3 | pages = 233–9 | date = September 2012 | pmid = 22831390 | doi = 10.2174/187152412802430156 }}{{cite journal | vauthors = Schuelert N, McDougall JJ | title = The abnormal cannabidiol analogue O-1602 reduces nociception in a rat model of acute arthritis via the putative cannabinoid receptor GPR55 | journal = Neuroscience Letters | volume = 500 | issue = 1 | pages = 72–6 | date = August 2011 | pmid = 21683763 | doi = 10.1016/j.neulet.2011.06.004 | s2cid = 3410391 }}{{cite journal | vauthors = Schicho R, Bashashati M, Bawa M, McHugh D, Saur D, Hu HM, Zimmer A, Lutz B, Mackie K, Bradshaw HB, McCafferty DM, Sharkey KA, Storr M | display-authors = 3 | title = The atypical cannabinoid O-1602 protects against experimental colitis and inhibits neutrophil recruitment | journal = Inflammatory Bowel Diseases | volume = 17 | issue = 8 | pages = 1651–64 | date = August 2011 | pmid = 21744421 | pmc = 3116968 | doi = 10.1002/ibd.21538 }}{{cite journal | vauthors = Díaz-Arteaga A, Vázquez MJ, Vazquez-Martínez R, Pulido MR, Suarez J, Velásquez DA, López M, Ross RA, de Fonseca FR, Bermudez-Silva FJ, Malagón MM, Diéguez C, Nogueiras R | display-authors = 3 | title = The atypical cannabinoid O-1602 stimulates food intake and adiposity in rats | journal = Diabetes, Obesity & Metabolism | volume = 14 | issue = 3 | pages = 234–43 | date = March 2012 | pmid = 21981246 | doi = 10.1111/j.1463-1326.2011.01515.x | s2cid = 26435270 | hdl = 20.500.11940/639 | hdl-access = free }}{{cite journal | vauthors = Kargl J, Haybaeck J, Stančić A, Andersen L, Marsche G, Heinemann A, Schicho R |display-authors=3 | title = O-1602, an atypical cannabinoid, inhibits tumor growth in colitis-associated colon cancer through multiple mechanisms | journal = Journal of Molecular Medicine | volume = 91 | issue = 4 | pages = 449–58 | date = April 2013 | pmid = 22965195 | pmc = 3529923 | doi = 10.1007/s00109-012-0957-1 }}{{cite journal | vauthors = McHugh D, Wager-Miller J, Page J, Bradshaw HB | title = siRNA knockdown of GPR18 receptors in BV-2 microglia attenuates N-arachidonoyl glycine-induced cell migration | journal = Journal of Molecular Signaling | volume = 7 | issue = 1 | pages = 10 | date = July 2012 | pmid = 22834922 | pmc = 3493281 | doi = 10.1186/1750-2187-7-10 | doi-access = free }}{{cite journal | vauthors = Caldwell MD, Hu SS, Viswanathan S, Bradshaw H, Kelly ME, Straiker A |display-authors=3| title = A GPR18-based signalling system regulates IOP in murine eye | journal = British Journal of Pharmacology | volume = 169 | issue = 4 | pages = 834–43 | date = June 2013 | pmid = 23461720 | pmc = 3687663 | doi = 10.1111/bph.12136 }}

See also

References

{{reflist}}

{{Cannabinoids}}

Category:Cannabinoids

Category:Cyclohexenes