O-2172

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449583877

| IUPAC_name = methyl 2-cyclopentyl-2-(3,4-dichlorophenyl)acetate

| image = O-2172 Structure.svg

| width =

| tradename =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 521062-92-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SPK6RB6JMK

| ATC_suffix =

| PubChem = 11778793

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9953475

| C=14 | H=16 | Cl=2 | O=2

| smiles = Clc1ccc(cc1Cl)C(C(=O)OC)C2CCCC2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H16Cl2O2/c1-18-14(17)13(9-4-2-3-5-9)10-6-7-11(15)12(16)8-10/h6-9,13H,2-5H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NEHPFNBRZYFWFN-UHFFFAOYSA-N

}}

O-2172 is a drug developed by Organix Inc, which acts as a stimulant and potent dopamine reuptake inhibitor. It is an analogue of methylphenidate where the phenyl ring has had a 3,4-dichloro substitution added, and the piperidine ring has been replaced by cyclopentane. It is around 1/3 the potency of methylphenidate, demonstrating that even with the important binding group of the nitrogen lone pair removed entirely, selective DAT binding and reuptake inhibition is still possible.{{cite journal | vauthors = Meltzer PC, Wang P, Blundell P, Madras BK | title = Synthesis and evaluation of dopamine and serotonin transporter inhibition by oxacyclic and carbacyclic analogues of methylphenidate | journal = Journal of Medicinal Chemistry | volume = 46 | issue = 8 | pages = 1538–45 | date = April 2003 | pmid = 12672255 | doi = 10.1021/jm0205292 }}{{cite journal | vauthors = Runyon SP, Carroll FI | title = Dopamine transporter ligands: recent developments and therapeutic potential | journal = Current Topics in Medicinal Chemistry | volume = 6 | issue = 17 | pages = 1825–43 | pmid = 17017960 | doi = 10.2174/156802606778249775 | year = 2006 }}