OSU-6162

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (3S)-3-[3-(methylsulfonyl)phenyl]-1-propylpiperidine

| image = OSU-6162.svg

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 156907-84-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V5SBJBUJW6

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9795741

| ChEMBL = 311730

| ChemSpiderID = 7971507

| C=15 | H=23 | N=1 | O=2 | S=1

| smiles = CCCN1CCC[C@H](C1)C2=CC(=CC=C2)S(=O)(=O)C

| StdInChI = 1S/C15H23NO2S/c1-3-9-16-10-5-7-14(12-16)13-6-4-8-15(11-13)19(2,17)18/h4,6,8,11,14H,3,5,7,9-10,12H2,1-2H3/t14-/m1/s1

| StdInChIKey = GZVBVBMMNFIXGE-CQSZACIVSA-N

| synonyms =

}}

OSU-6162 (PNU-96391) is a compound which acts as a partial agonist at both dopamine D₂ receptors and 5-HT_2A receptors. It acts as a dopamine stabilizer in a similar manner to the closely related drug pridopidine, and has antipsychotic, anti-addictive and anti-Parkinsonian effects in animal studies.{{cite journal | vauthors = Ekesbo A, Andrén PE, Gunne LM, Tedroff J | title = (-)-OSU 6162 inhibits levodopa-induced dyskinesias in a monkey model of Parkinson's disease | journal = NeuroReport | volume = 8 | issue = 11 | pages = 2567–70 | date = July 1997 | pmid = 9261828 | doi = 10.1097/00001756-199707280-00029 | s2cid = 29806568 }}{{cite journal | vauthors = Tedroff J, Torstenson R, Hartvig P, Sonesson C, Waters N, Carlsson A, Neu H, Fasth KJ, Långström B | display-authors = 6 | title = Effects of the substituted (S)-3-phenylpiperidine (-)-OSU6162 on PET measurements in subhuman primates: evidence for tone-dependent normalization of striatal dopaminergic activity | journal = Synapse | volume = 28 | issue = 4 | pages = 280–7 | date = April 1998 | pmid = 9517836 | doi = 10.1002/(SICI)1098-2396(199804)28:4<280::AID-SYN3>3.0.CO;2-5 | s2cid = 2090820 }}{{cite journal | vauthors = Tedroff J, Ekesbo A, Sonesson C, Waters N, Carlsson A | title = Long-lasting improvement following (-)-OSU6162 in a patient with Huntington's disease | journal = Neurology | volume = 53 | issue = 7 | pages = 1605–6 | date = October 1999 | pmid = 10534281 | doi = 10.1212/wnl.53.7.1605 }}{{cite journal | vauthors = Nichols NF, Cimini MG, Haas JV, Staton BA, Tedroff J, Svensson KA | title = PNU-96391A (OSU6162) antagonizes the development of behavioral sensitization induced by dopamine agonists in a rat model for Parkinson's disease | journal = Neuropharmacology | volume = 43 | issue = 5 | pages = 817–24 | date = October 2002 | pmid = 12384167 | doi = 10.1016/s0028-3908(02)00144-2 | s2cid = 22101873 }}{{cite journal | vauthors = Tamminga CA, Carlsson A | title = Partial dopamine agonists and dopaminergic stabilizers, in the treatment of psychosis | journal = Current Drug Targets. CNS and Neurological Disorders | volume = 1 | issue = 2 | pages = 141–7 | date = April 2002 | pmid = 12769623 | doi = 10.2174/1568007024606195 }}{{cite journal | vauthors = Brandt-Christensen M, Andersen MB, Fink-Jensen A, Werge T, Gerlach J | title = The substituted (S)-3-phenylpiperidine (-)-OSU6162 reduces apomorphine- and amphetamine-induced behaviour in Cebus apella monkeys | journal = Journal of Neural Transmission | volume = 113 | issue = 1 | pages = 11–9 | date = January 2006 | pmid = 15795789 | doi = 10.1007/s00702-005-0297-1 | s2cid = 21099503 }}{{cite journal | vauthors = Rung JP, Carlsson A, Markinhuhta KR, Carlsson ML | title = The dopaminergic stabilizers (-)-OSU6162 and ACR16 reverse (+)-MK-801-induced social withdrawal in rats | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 29 | issue = 5 | pages = 833–9 | date = June 2005 | pmid = 15913873 | doi = 10.1016/j.pnpbp.2005.03.003 | s2cid = 20868201 }}{{cite journal | vauthors = Natesan S, Svensson KA, Reckless GE, Nobrega JN, Barlow KB, Johansson AM, Kapur S | title = The dopamine stabilizers (S)-(-)-(3-methanesulfonyl-phenyl)-1-propyl-piperidine [(-)-OSU6162] and 4-(3-methanesulfonylphenyl)-1-propyl-piperidine (ACR16) show high in vivo D2 receptor occupancy, antipsychotic-like efficacy, and low potential for motor side effects in the rat | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 318 | issue = 2 | pages = 810–8 | date = August 2006 | pmid = 16648369 | doi = 10.1124/jpet.106.102905 | s2cid = 9385308 }}{{cite journal | vauthors = Seeman P, Guan HC | title = Dopamine partial agonist action of (-)OSU6162 is consistent with dopamine hyperactivity in psychosis | journal = European Journal of Pharmacology | volume = 557 | issue = 2–3 | pages = 151–3 | date = February 2007 | pmid = 17157291 | doi = 10.1016/j.ejphar.2006.11.016 }}{{cite journal | vauthors = Lahti RA, Tamminga CA, Carlsson A | title = Stimulating and inhibitory effects of the dopamine "stabilizer" (-)-OSU6162 on dopamine D2 receptor function in vitro | journal = Journal of Neural Transmission | volume = 114 | issue = 9 | pages = 1143–6 | date = September 2007 | pmid = 17612788 | doi = 10.1007/s00702-007-0784-7 | s2cid = 23496944 }}{{cite journal | vauthors = Rung JP, Rung E, Helgeson L, Johansson AM, Svensson K, Carlsson A, Carlsson ML | title = Effects of (-)-OSU6162 and ACR16 on motor activity in rats, indicating a unique mechanism of dopaminergic stabilization | journal = Journal of Neural Transmission | volume = 115 | issue = 6 | pages = 899–908 | date = June 2008 | pmid = 18351286 | doi = 10.1007/s00702-008-0038-3 | s2cid = 20687327 }}{{cite journal | vauthors = Benaliouad F, Kapur S, Natesan S, Rompré PP | title = Effects of the dopamine stabilizer, OSU-6162, on brain stimulation reward and on quinpirole-induced changes in reward and locomotion | journal = European Neuropsychopharmacology | volume = 19 | issue = 6 | pages = 416–30 | date = June 2009 | pmid = 19269794 | doi = 10.1016/j.euroneuro.2009.01.014 | s2cid = 19419177 }}{{cite journal | vauthors = Dyhring T, Nielsen EØ, Sonesson C, Pettersson F, Karlsson J, Svensson P, Christophersen P, Waters N | display-authors = 6 | title = The dopaminergic stabilizers pridopidine (ACR16) and (-)-OSU6162 display dopamine D(2) receptor antagonism and fast receptor dissociation properties | journal = European Journal of Pharmacology | volume = 628 | issue = 1–3 | pages = 19–26 | date = February 2010 | pmid = 19919834 | doi = 10.1016/j.ejphar.2009.11.025 }}{{cite journal | vauthors = Kara E, Lin H, Svensson K, Johansson AM, Strange PG | title = Analysis of the actions of the novel dopamine receptor-directed compounds (S)-OSU6162 and ACR16 at the D2 dopamine receptor | journal = British Journal of Pharmacology | volume = 161 | issue = 6 | pages = 1343–50 | date = November 2010 | pmid = 20804495 | pmc = 3000658 | doi = 10.1111/j.1476-5381.2010.01010.x }} Both enantiomers show similar activity but with different ratios of effects, with the (S) enantiomer (–)-OSU-6162 that is more commonly used in research, having higher binding affinity to D₂ but is a weaker partial agonist at 5-HT_2A, while the (R) enantiomer (+)-OSU-6162 has higher efficacy at 5-HT_2A but lower D₂ affinity.{{cite journal | vauthors = Carlsson ML, Burstein ES, Kloberg A, Hansson S, Schedwin A, Nilsson M, Rung JP, Carlsson A | display-authors = 6 | title = I. In vivo evidence for partial agonist effects of (-)-OSU6162 and (+)-OSU6162 on 5-HT2A serotonin receptors | journal = Journal of Neural Transmission | volume = 118 | issue = 11 | pages = 1511–22 | date = November 2011 | pmid = 21874578 | doi = 10.1007/s00702-011-0704-8 | s2cid = 43580367 }}{{cite journal | vauthors = Burstein ES, Carlsson ML, Owens M, Ma JN, Schiffer HH, Carlsson A, Hacksell U | title = II. In vitro evidence that (-)-OSU6162 and (+)-OSU6162 produce their behavioral effects through 5-HT2A serotonin and D2 dopamine receptors | journal = Journal of Neural Transmission | volume = 118 | issue = 11 | pages = 1523–33 | date = November 2011 | pmid = 21866391 | doi = 10.1007/s00702-011-0701-y | s2cid = 763630 }}