Octatropine methylbromide

{{Short description|Pharmaceutical drug}}

{{drugbox

| Verifiedfields = changed

| Watchedfields = changed

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 62M960DHIL| verifiedrevid = 376110842

| IUPAC_name = (endo)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-propylpentanoate bromide

| image = Octatropine methylbromide.svg

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 80-50-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 6647

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00517

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00232

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1186610

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10482228

| smiles = CCCC(CCC)C(=O)O[C@H]1C[C@H]2CC[C@@H](C1)[N+]2(C)C.[Br-]

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H32NO2.BrH/c1-5-7-13(8-6-2)17(19)20-16-11-14-9-10-15(12-16)18(14,3)4;/h13-16H,5-12H2,1-4H3;1H/q+1;/p-1/t14-,15+,16+;

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QSFKGMJOKUZAJM-CNKDKAJDSA-M

| C=17 | H=32 | N=1 | O=2 | Br=1

| synonyms = 8-Methyltropinium bromide 2- propylvalerate

| bioavailability = 10 to 25% (oral)

| protein_bound = Unknown

| metabolism = Hepatic

| elimination_half-life = Unknown

| excretion =

| pregnancy_AU =

| pregnancy_US = C

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

}}

Octatropine methylbromide (INN) or anisotropine methylbromide (USAN), trade names Valpin, Endovalpin, Lytispasm and others,{{cite book | vauthors = Triggle DJ, Ganellin CR, MacDonald F |title=Dictionary of Pharmacological Agents |publisher=Chapman & Hall/CRC |location=Boca Raton |year=1997 |volume=2 |pages=1467 |isbn=0-412-46630-9 |url=https://books.google.com/books?id=A0THacd46ZsC}} Retrieved on August 31, 2008 through Google Book Search. is a muscarinic antagonist and antispasmodic. It was introduced to the U.S. market in 1963 as an adjunct in the treatment of peptic ulcer,{{cite journal | vauthors = Batterman RC, Mouratoff GJ, Kaufman JE | title = Anisotropine methylbromide: a new antispasmodic for gastrointestinal disorders | journal = Current Therapeutic Research, Clinical and Experimental | volume = 5 | pages = 213–218 | date = May 1963 | pmid = 13966843 }} and promoted as being more specific to the gastrointestinal tract than other anticholinergics, although its selectivity was questioned in later studies.{{cite book | vauthors = Gyermek L | chapter = Semisynthetic Derivatives of Tropane Alkaloids and o Other Atropine Esters |title=Pharmacology of antimuscarinic agents |publisher=CRC Press |location=Boca Raton |year=1998 |pages=183 |isbn=0-8493-8559-8 | chapter-url=https://books.google.com/books?id=_VyDxfdunv4C&q=anisotropine&pg=PA183}} Retrieved on August 31, 2008 through Google Book Search.{{cite journal | vauthors = Bachrach WH | title = Clinical evaluation of anisotropine methyl bromide (valpin), an anticholinergic drug | journal = The American Journal of Digestive Diseases | volume = 17 | issue = 6 | pages = 505–512 | date = June 1972 | pmid = 4555460 | doi = 10.1007/BF02231205 | s2cid = 7836183 }}

Octatropine has been superseded by more effective agents in the treatment of peptic ulcer disease, and is no longer used. It is still sold in some countries in combination with other drugs, such as phenobarbital and metamizole.

References

{{Reflist}}

{{Drugs for functional gastrointestinal disorders}}

{{Muscarinic acetylcholine receptor modulators}}

Category:Muscarinic antagonists

Category:Tropanes

Category:Carboxylate esters

Category:Quaternary ammonium compounds

Category:Antispasmodics

{{gastrointestinal-drug-stub}}