Oil Blue 35

{{Chembox

| ImageFile = Oil Blue 35 Structural Formula V1.svg

| ImageSize = 200px

| ImageAlt = Structural formula of Oil Blue 35

| ImageFile1 = Oil Blue 35 3D ball.png

| ImageAlt1 = Ball-and-stick model of the Oil Blue 35 molecule

| IUPACName = 1,4-Bis(butylamino)anthraquinone

| PIN = 1,4-Bis(butylamino)anthracene-9,10-dione

| OtherNames = {{unbulleted list|Solvent Blue 35|Blue 2N|Blue B|Oil Blue B|CI 61554}}

|Section1={{Chembox Identifiers

| CASNo = 17354-14-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZVT4Q30OQY

| PubChem = 3766139

| SMILES = O=C2c1ccccc1C(c3c2c(NCCCC)ccc3NCCCC)=O

| EINECS = 241-379-4

| ChemSpiderID = 2994956

| InChI = 1/C22H26N2O2/c1-3-5-13-23-17-11-12-18(24-14-6-4-2)20-19(17)21(25)15-9-7-8-10-16(15)22(20)26/h7-12,23-24H,3-6,13-14H2,1-2H3

| InChIKey = OCQDPIXQTSYZJL-UHFFFAOYAW

| StdInChI = 1S/C22H26N2O2/c1-3-5-13-23-17-11-12-18(24-14-6-4-2)20-19(17)21(25)15-9-7-8-10-16(15)22(20)26/h7-12,23-24H,3-6,13-14H2,1-2H3

| StdInChIKey = OCQDPIXQTSYZJL-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=22 | H=26 | N=2 | O=2

| Appearance =

| Density =

| MeltingPtC = 104-105

| BoilingPt =

| Solubility = insoluble

| SolubleOther = acetone, benzene, and toluene

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Oil Blue 35{{Cite web |title=Oil Blue 35 {{!}} C22H26N2O2 {{!}} ChemSpider |url=http://www.chemspider.com/Chemical-Structure.2994956.html |access-date=2022-11-23 |website=www.chemspider.com}} is a blue anthraquinone dye used for colouring alcoholic and hydrocarbon based solvents, including oils, fats, and waxes. It is used also in lacquers and inks. In some countries, it is used as a fuel dye. It is also used in some blue colored smoke formulations. In microscopy, it is used as a staining dye. When exposed to 5% hydrochloric acid solution, it becomes dirty green.

See also

References